Which of the following amino acids has a side chain that is capable of hydrogen bonding with other polar molecules?
a. Leu
b. Ser
c. Ala
d. Gly

The quantum numbers for the very last electron in Cadmium (Cd) atom is  (5, 0, 0, ±¹/₂) for the four quantum numbers.

Quantum numbers are the set of numbers used to express the location and energy of an electron in an atom.

There are four quantum numbers used to describe the location and energy of an electron in an atom, and they are:

The electronic configuration of cadmium is  [Kr]4d¹⁰5s².

Hence, cadmium belongs to period 5 of the periodic table, and the last electron occupies the 5s orbital.

The l value of the s orbital is 0, and mi is 0 as well.

The value of ms is ±¹/₂.

Learn more about quantum numbers at: https://brainly.com/question/2292596

#SPJ1

The strongest nucleophile is C: NH3.

The strongest nucleophile is the compound that can donate its electrons the most effectively to form a covalent bond with an electron-deficient species (electrophile).

Out of the compounds listed, NH3 is the strongest nucleophile. This is because nitrogen atoms in NH3 have an unshared pair of electrons that are highly polarized and readily available for bonding.

Methoxide (MeO-) is a nucleophile, but it is less basic than NH3 because the oxygen atom is an electron-withdrawing group and is less able to donate electrons.

Methanol (MeOH) is not a nucleophile, as it does not have a lone pair of electrons that can be used for bonding.

Methyl (Me-) is not a nucleophile as it is not a compound, a methyl is just a functional group that can be bound to various atoms or molecules, but it doesn't have any electron pair to donate.

So NH3 is the strongest nucleophile.

You can learn more about strongest nucleophile at

https://brainly.com/question/27548316

#SPJ4

C. Pipet Analytical balance,It is expected that the accuracy of the following equipment will be examined depending on the equipment listed: Thermometer Graduated Cylinder Thermometer Buret C.

Pipet Analytical balance, part E These tools are frequently used in scientific experiments to measure volume, temperature, and weight. It's also crucial to understand the difference between accuracy and precision. While precision refers to the reproducibility of a series of measurements, accuracy relates to how near a measurement is to the real value of the quantity being measured.While 10 ml graduated cylinders feature marks every tenth of a milliliter, most 50 ml graduated cylinders have markings spaced every milliliter. Our measurement should be more precise if we use a 10 ml graduated container than if we use a 50 ml graduated container. We refer to an instrument as being ACCURATE if it produces values that are extremely near to the genuine value. Example: The same sample was measured three times using a graduated cylinder, yielding readings of 566 mL, 584 mL, and 541 mL. These three figures add out to 563.7 mL on average.

learn more about cylinder  here:

https://brainly.com/question/16134180

#SPJ4

Answer:

To calculate the volume of the piece of iron, we need to divide its mass by its density. But first, we need to express the density in the same units as the mass, which is kg/dL. To do this, we need to convert the density from g/cm3 to kg/dL.

1 cm3 = 1 mL = 0.001 L

1 dL = 0.1 L

Therefore, 1 cm3 = 0.001 L = 0.1 dL

Also, 1 g = 0.001 kg

Therefore,

density in kg/dL = (density in g/cm3) * (1 kg/1000 g) * (0.1 dL/1 cm3)

= 7.86 g/cm3 * 0.001 kg/g * 0.1 dL/cm3

= 0.00786 kg/dL

Now we can use this density to calculate the volume of the piece of iron:

Volume = mass / density

= 4.62 kg / 0.00786 kg/dL

= 5892.9 dL

So, the volume of the piece of iron is 5892.9 dL.

Answer: 0.889 meters

Explanation:

There are three chemically non-equivalent hydrogens present in 3-chlorocyclopentene.

Non-equivalent hydrogens are groups which have the property of  distinctive synthetic movements. We will find the same number of signs in an NMR spectrum along its lines due to the non-equivalent hydrogens.

These non-equivalent hydrogens can be determined by finding out whether a molecule is symmetric or not at first.

In the molecular structure of 3-chlorocyclopentene, chlorine is attached to the third position of the cyclopentene ring. There are four hydrogen atoms attached to the cyclopentene ring, and out of these four  hydrogen atoms, three hydrogen atoms have different environments, so there are three chemically non-equivalent hydrogens in its structure.

To know more about non-equivalent hydrogen here

https://brainly.com/question/28480636

#SPJ4

The question about compounds that is most likely to be answered by the analysis is a) what is the formula unit of each compound?

The elemental analysis of two different ionic compounds, both of which contain only copper and chlorine, can be used to determine the formula unit of each compound.

An ionic compound is a type of chemical bond formed by the attraction between ions with opposite charges. In this case, the two different ionic compounds, which are powders, one white and one brown, contain only copper and chlorine ions.

The elemental analysis will help to determine the ratio between the copper and chlorine ions in the compound, which in turn will give the formula unit for each compound.

By conducting an elemental analysis on the two powders, one can answer the question of what the formula unit of each compound is. Hence, option a is correct.

This is because an elemental analysis can determine the elements present in a given compound, as well as the ratio between them. Knowing the elements present in a compound and their ratio allows us to determine the formula unit of the compound.

Although a part of your question is missing, you might be referring to this question:

Two different ionic compounds each contain only copper and chlorine. both compounds are powders, one white and one brown. An elemental analysis is performed on each powder. Which of the following questions about the compounds is most likely to be answered by the results of the analysis?

a) what is the formula unit of each compound?

b) what is the molecular mass of each compound?

c) What is ratio or each compound?

d) none of the above

To learn more about analysis, click here:

https://brainly.com/question/29926939

#SPJ4

D. Distillation, because the liquids would boil at different temperatures owing to the difference in the strength of their intermolecular forces.

Key points:

Learn more about Distillation here:

https://brainly.com/question/24553469

#SPJ4

[tex]\huge\underline{\red{A}\green{n}\blue{s}\purple{w}\pink{e}\orange{r} -»}[/tex]

Explanation:

Answer:

64.2 L

Explanation:

In order to be able to calculate the volume of oxygen gas produced by this reaction, you need to know the conditions for pressure and temperature.

Since no mention of those conditions was made, I'll assume that the reaction takes place at STP, Standard Temperature, and Pressure.

Under these conditions for pressure and temperature, one mole of any ideal gas occupies 22.7 L

- this is known as the molar volume of a gas at STP.

So, in order to find the volume of oxygen gas at STP, you need to know how many moles of oxygen are produced by this reaction.

The balanced chemical equation for this decomposition reaction looks like this:

2KClO3(s] −−−→2KCl(s]+3O2(g]↑

Notice that you have a 2/3 mole ratio between potassium chlorate and oxygen gas. This tells you that the reaction will always produce 3/2 times more moles of oxygen gas than the number of moles of potassium chlorate that underwent decomposition.

Use potassium chlorate's molar mass to determine how many moles you have in that 231-g sample.

231g ⋅ 1 mole KClO3/ 122.55g = 1.885 moles KClO3

Use the aforementioned mole ratio to determine how many moles of oxygen would be produced from this many moles of potassium chlorate

1.885 moles KClO3 ⋅ 3 moles O2/2 moles KClO3 = 2.8275 moles O2

So, what volume would this many moles occupy at STP?

2.8275 moles ⋅ 22.7 L/ 1mol = 64.2 L

This was alotta info but i hope it helped

Because it takes no energy to generate a naturally occurring compound, the enthalpy of formation for an element in its elemental state will always be 0.

The free energy shift that happens when 1 mole of a material is created from its component elements in their standard states is referred to as the standard free energy of formation. The standard free energy of production of a pure element in its standard state is zero.

The distinction between Gibbs free energy and standard free energy is that the former is dependent on the experimental circumstances, whilst the latter describes the Gibbs free energy for reactants and products in their standard state.

learn more about standard free energy

https://brainly.com/question/14415025

#SPJ1

Lithium sulfide and cobalt (III) bromide are mixed in equimolar solutions. Chemical equation that is balanced:

In the equation CoBr3(aq) + Li2S(aq) ---> LiBr(aq) + CoS(s), each component can be identified as follows:

In this reaction, cobalt (III) bromide and lithium sulfide react to form lithium bromide and cobalt sulfide. The reactants are equimolar solutions, meaning that there are equal amounts of each reactant. When the two solutions are mixed, the cobalt (III) ions and lithium ions come into contact and form an ionic bond, which results in the formation of new solid cobalt sulfide and aqueous lithium bromide.

Learn more about balanced chemical equation here: brainly.com/question/11904811

#SPJ4

The volume of the gold sample, given the theoretical density and the mass, is 1.23 ml

When given the theoretical density of a gold sample and the mass, you can use the formula for density to find the volume of the gold sample.

The volume for density is:

Density = Mass / Volume

Mass = 23. 82 g

Density = 19. 30 g / ml

The volume is:

19.30 = 23 .82 / Volume

Volume x 19. 30 = 23. 82

Volume = 23. 82 / 19. 30

= 1.23 ml

Find out more on volume at https://brainly.com/question/28717703

#SPJ1

The full question is:

A sample of gold has a mass of 23.82 g, given that the theoretical density is 19.30 g/ml, what is the volume of the gold sample?

Answer:

Explanation:

The atomic mass of the nitrogen atom is 14

The rank order of acidity is para nitro phenol > meta nitro phenol > phenol > Para amino phenol.

The nitro group is a powerful electron withdrawing group. As a result, by removing electron density from the carboxylate ion, it increases the acidity of benzoic acid. This effect is strongest when the nitro group is in the ortho position (the effect is known as ortho effect).

The chemical structure of an acid can be used to predict its relative strength. An acid is generally stronger when the H-A bond is more polar. When the H-A bond is weaker and the conjugate base, A, is more stable, acidity increases.

Thus, The rank order of acidity is para nitro phenol > meta nitro phenol > phenol > Para amino phenol.

To learn more about acidity order, follow the link;

https://brainly.com/question/9423359

#SPJ1

The polarity of the bond expressed in terms of the dipole moment. which is given the symbol mu and which will takes into account not only the electronegativity difference between the two bonded elements but also for  the distance between their centers.

A polar covalent bond is meant to have the dipole, which exists whenever the opposite charges are separated from the each other.

The polarity of the bond will be expressed in terms of the dipole moment, which is given the symbol mu and which will takes into the account not only for the electronegativity difference between the two bonded elements but also for  the distance between their centers. The Covalent bonds are formed by the sharing of the electrons between the two atoms. The molecule with the dipole moment zero are non polar molecule.

The question is incomplete, the complete question is :

A polar covalent bond is said to have a dipole, which exists whenever opposite charges are separated from each other. The polarity of the bond can be expressed in terms of a dipole _____, which is given the symbol "mu" and which takes into account not only the ___ difference between the two bonded elements but also the ____ between their centers.

To learn more about polar bond here

https://brainly.com/question/14992889

#SPJ4

P=17.4 KPa is the pressure exerted on the wall.

A t = 1.00s

A = 8x10" m²,

N = 5x10^23 molecules

ΔV = 300 m/s

P=?

As, Momentum for I molecule is 2 MΔV

N molecules is 2N MΔV

Force exerted on the wall = Momentum/Δt

Also, So, Pressure exented on the wall

P= F /A = 2NMΔV/AΔt=2×5×10^23×4.65×10^-26×300/8×10^-4×1

P=17.4 KPa

What do pressure units mean?

The standard unit of pressure is a pascal (Pa). Given that a pascal is a very small unit of pressure, the kilopascal is the most appropriate measurement for commonplace gas pressures (kPa). 1000 pascals make up one kilopascal. The atmosphere is another frequently used measurement of pressure (atm).

Learn more about Pressure:

brainly.com/question/28012687

#SPJ4

Answer:

E. Cleavage of diamonds is a random property and differs from stone to stone.

Syringes, catheters, and other items that cannot tolerate high heat or contact with liquids during the sterilization process are frequently sterilized using ethylene oxide (EtO).

The chemical compound ethylene oxide, also known as EO or EtO, has the formula C2H4O. It is a tasteless, ether-like gas that is combustible and colorless.

Packaging can be penetrated by ethylene oxide gas, which can also sanitize contents without endangering them. Although it is a liquid, 70% isopropyl alcohol solution is also used to sterilize medical devices; however, this solution is often sprayed on surfaces outside of the packaging. It is uncommon to sterilize medical equipment using phenol derivatives or cationic detergent. It is crucial to remember that EtO is a hazardous gas and should only be handled by qualified individuals in an environment with adequate ventilation.

To know more about ethylene oxide, visit:

brainly.com/question/28303854

#SPJ4

a. To calculate the density of a substance, divide its mass by its volume. In this case, the density would be:

0.100 g / 10.00 ml = 0.01 g/ml

The density has two significant figures, as it was given in the question.

b. To calculate the molar mass of Ag2O, you would need to know the atomic masses of silver (Ag) and oxygen (O) and multiply them by the number of atoms of each element in the compound. Ag2O is made up of 2 atoms of silver and 1 atom of oxygen, so the molar mass would be:

(2 x 107.87 g/mol) + (1 x 16.00 g/mol) = 231.87 g/mol

The molar mass has four significant figures, as it was calculated using the given atomic masses.

c. The following burette measurements were collected for a titration experiment:

Initial burette reading: 0.300 ml.

Final burette reading: 23.45 ml.

The volume of solution used in the titration would be the difference between the final and initial burette readings, which is:

23.45 ml - 0.300 ml = 23.15 ml

To learn more about burette measurements:

https://brainly.com/question/28353349

#SPJ4

You may use the following equation to get each stream's mass flow rate: concentration times flow rate equals mass flow rate. Mass flow rate for Stream 1 is 300 mm (heparin) times flow rate determine by other means

The amount of fluid passing through a pipe or other conduit in a specific amount of time is measured as the flow rate. It is frequently expressed in terms of volume/time, such as gallons/minute or cubic meters/second. Numerous variables, such as the pipe's size and form, the fluid's pressure, and its viscosity, can have an impact on the flow rate. In some circumstances, the flow rate may be managed by valves or other equipment like flow metres or pumps. Numerous sectors, including water treatment, oil and gas extraction, and manufacturing, depend on knowing and managing flow rate. such as cubic feet per second (cf/s) or

Learn more about flow rate here:

https://brainly.com/question/27880305

#SPJ4

In this case, multiplying 0.35 by 55 gives us the number 19. 25.2 m squared plus three squares is a match. This is equivalent to the third square of 20 by 25.4.

To learn more about significant numbers refer to:

https://brainly.com/question/24491627

#SPJ1

One of five fundamental types can be applied to a wide variety of chemical processes.To accurately forecast the byproducts of an unknown reaction, a detailed grasp of various kinds of reactions is helpful.

To learn more about chemical reactions refer

https://brainly.com/question/11231920

#SPJ1

The reactivity of the elements in group 2 would increase down the group.

We have to note that when we are talking about the reactivity of the elements we are looking at how easiliy the elements are able to engage in the process of chemical combination.

For the group two elements, they are highly reactive but not as reactive as the elements that we can find in group 1. The reactivity of the element is that are in group 2 would increase as we move down the group of the elements.

Learn more about reactivity:https://brainly.com/question/1598581

#SPJ1

Sulfosalicylic acid is a secondary method that can be used to determine the presence of Protein in urine.

Sulfosalicylic acid (SSA) is a secondary method that can be used to determine the presence of proteins in urine if colour interference prevents the accurate reading of a urine chemical reagent strip. The reagent strip is a primary screening method for detecting proteins in urine, but certain substances can cause colour interference and make it difficult to accurately interpret the results. In these cases, SSA can be used as a confirmatory test.

The SSA test works by precipitating proteins in the urine sample. The resulting protein precipitate is then centrifuged and the supernatant is removed. The protein pellet is dissolved in a small amount of acid and the solution is then analyzed spectrophotometrically.

Learn more about Protiens here: https://brainly.com/question/13734713

#SPJ4

The fill in the blanks is as follows :

a) Sodium and chloride ions

b) Chloride ions

c) Sodium ions

a) When sodium chloride, NaCl , dissolves in the water, the solution contains sodium and chloride ions in the addition to the water solvent.

b) The partial charges in the water help to dissolve the compound as the hydrogen end of the water is attracted to the chloride ions and the oxygen end is attracted to the sodium ions.

The Sodium chloride (NaCl) is an ionic compound. The sodium chloride is formed by the ionic bond. the ionic bond is formed between the negatively charged ion and the positively charged ion.

To learn more about sodium chloride here

https://brainly.com/question/24188706

#SPJ4

Answer:

2nd and 3rd

Explanation:

A K-value >> 1 typically indicates a lot more of the product (in this case B) than the reactants. So K = 7000 and K = [tex]8*10^5[/tex] matches that description.

The location in atom : In the nucleus

The Charge : + 1 elementary charge

The Approximate Mass = 1.0073 amu

The nucleus of an atom contains the protons, electrons and the neutrons. The Protons are the positively charged species, the electrons are negatively charged species and the neutrons have no charge means it is neutral. For the neutral atom the number of the protons is equals to the number of the electrons. The approximate mass of the proton is 1.0073 amu.

Thus, The Protons location is inside nucleus of an atom , the proton has the elementary charge of + 1.  The approx mass is the 1.0073 amu.

To learn more about protons here

https://brainly.com/question/30362057

#SPJ4

Answer:

Pb(NO3)2+K2CrO4=2KNO3+PbCrO4