Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
Complete the missing information in the reactions. Then, label the reaction one of the following:
Alpha Decay
Electron Capture
Beta Decay
Positron Emission
.
14
N +
0
Type:
238
92
234
90
Th +
Type:
15
0
15
N +
7
Type:
8
0
32
15
Type:
105
Ag +
47
105
Pd
46
Type:
40
Type:
20
I
244
94 Pu -
Type: :
which system does the endocrine gland influence to fight infections
Answer:
Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops
2. What percentage of the offspring
will have the red flowers?
Answer:
1/4 of the offspeing will have the red flowers
Circle the letter next to each sentence that is true concerning the compressibility of gases. a. The large relative distances between particles in a gas means that there is considerable empty space between the particles. b. The assumption that particles in a gas are relatively far apart explains gas compressibility. c. Compressibility is a measure of how much the volume of matter decreases under pressure. d. Energy is released by a gas when it is compressed.
Answer:
The large relative distances between particles in a gas means that there is considerable empty space between the particles.
The assumption that particles in a gas are relatively far apart explains gas compressibility.
Compressibility is a measure of how much the volume of matter decreases under pressure.
Energy is released by a gas when it is compressed
Explanation:
The kinetic molecular theory establishes that gases are composed of molecules. These molecules of gas are far apart from each other hence there is a considerable empty space between the gas molecules. As a result of these empty spaces between gas molecules, it is possible to compress a gas.
Compressibility is defined as a measure of how much the volume of matter decreases under pressure. When a gas is compressed, work is done on the gas and energy is evolved hence the gas heats up.
define the term pure substance
Answer:
Pure substances are substances that are made up of only one kind of particles and has a fixed or constant structure. Pure substances are further classified as elements and compounds. An element is a substance that consists of only one type or kind of atom
Answer:
define the term pure substance :
A pure substance does not have to be of a single element or compound, This can either be one single element or one single compound, but every sample of this substance that you examine must contain exactly the same thing with a fixed, definite set of properties
Explanation:
Using the human species as an example, explain why physical appearance or morphology is NOT always useful for identifying organisms belonging to the same species.
Answer:
Get SNS
Explanation:
Calculate the molarity 14.1 moles of FeCl3 dissolved in 2350 ml of solution
You are given three liquids. You know that one of them is a suspension, one is a solution with nonelectrolytes, and the other is a solution with electrolytes. Describe the process by which you would differentiate between the three.
Answer:
decant/ filter then decompose the electrolytes by electrolysis
Explanation:
Differentiation of suspension solution is done by filtering and differentiation of electrolyte and non-electrolyte solution is done by electrolysis process.
What is electrolysis process?Electrolysis process is used to decompose the any electrolyte present in any solution into their constitute ions towards the cathodes and anodes under the electric flow of current.
Process which is required to differentiate suspension solution is filtering, because in this solution suspended insoluble particles are present which get filtered. Now to differentiate between non electrolyte and electrolyte solution we will use the electrolysis process, as non electrolyte solution do not show any behavior in this.
Hence, we use filtering and electrolysis process for the differentiation.
To know more about electrolysis, visit the below link:
https://brainly.com/question/25712870
do weight loss Subliminals work?
Answer:
Some early research suggests that subliminal messages may influence food- and diet-related thoughts and behaviors. However, other research has found that subliminal messages with weight loss cues have no effect.
Explanation:
I need help answer whenever I have time
Answer:
Lithosphere: Volcanos..
Hydrosphere: Rain falls..
biosphere: Plants..
Explanation:
How can water affect the rock cycle?
Water can cause rocks to break into sediments through mechanical weathering.
Water can cause rocks to be buried deep underground.
Water can cause rocks to melt.
Water can causer rocks to break into sediments through chemical weathering.
Answer:
b
Explanation:
b because it's a physical change
The driest desert on Earth is the several years to not receive any rainfall. desert. There it has been recorded for O Atacama Sahara (T) Antartic ( Gobi
Answer:
Atacama
Explanation:
How many atoms of hydrogen are there in one molecule of water. if the chemical formula is H202 ?
a. 0
b. 1
c. 2
d. 3
I have a Helium party balloon that can hold 3.0 liters of gas. If I blow up this balloon with 0.10 moles of oxygen gas at a pressure of 1.0 atmosphere, what is the temperature of the balloon?
Answer:
I am not yet sure on my answer
I would not want to give you wrong answers
Sorry
How do the mass number and atomic change as a particle goes through alpha decay?
How many grams are in 4.5 x 10^22 molecules of water? please show dimensional analysis
Answer:
1.1grams
Explanation:
Find moles of water:
4.5x10^22/(6.02x10^23)=0.07mol
Find molar mass of the water
O=16.00g/mol
0.07x 16.00=1.1 grams
If you want to change the mass of your atom by 1 or more mass units, you can ether
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron
If you want to change the mass of your atom by 1 or more mass units, you can either? Add a proton and Add a neutron.
Explanation:
Option A and Option B is your answers.
To change the mass of your atom by more mass units ; you can add a proton or add a neutron ( A and B )
The nucleus of an atom is composed of a neutron and a proton while the outer shell of an atom comprises of the electrons.
The mass of an atom is dependent on the mass of the nucleus of the atom therefore to increase the mass of the atom by any number of mass units you can either add a proton or a neutron to the nucleus of the cell.
Hence we can conclude that to change the mass of your atom you can add a proton or add a neutron to the nucleus of the atom
Learn more : https://brainly.com/question/14110259
the answer has to be 3 to 5 sentences for me to get full credit. ❤❤
Convert 16.8 L of nitrogen monoxide gas at STP to grams .
1.What is the coefficient of the scientific notation answer ?
2.What is the exponent of the scientific notation answer ? 3.How many significant figures are there in the answer?
4.What is the right most significant figure in the answer ?
Convert 12.5 grams of fluorine gas at STP to L.
1.What is the coefficient of the scientific notation answer? 2.What is the exponent of the scientific notation answer? 3.How many significant figures are there in the answer ?
4.What is the right most significant figure in the answer?
Answer:
See explanation
Explanation:
1 mole of a gas occupies 22.4 L
x moles occupies 16.8 L
x = 1 mole * 16.8 L/22.4 L
x = 0.75 moles
number of moles = mass/molar mass
mass = number of moles * molar mass
mass = 0.75 moles * 30.01 g/mol = 22.5075 g = 2.25 * 10^1 g
the coefficient of the scientific notation answer = 2.25
the exponent of the scientific notation answer = 1
significant figures are there in the answer = 6
the right most significant figure in the answer = 3
2.
number of moles = 12.5g/38g/mol = 0.3289 moles
1 mole occupies 22.4 L
0.3289 moles occupies 0.3289 moles * 22.4 L/1 mole
= 7.36736 L = 7.36736 * 10^0 L= 7.37 * 10^0 L
the coefficient of the scientific notation answer =7.37
the exponent of the scientific notation answer = 0
significant figures are there in the answer = 6
the right most significant figure in the answer= 3
Pick one answer do not put any links please
The image shows two spheres hung from a thin rope. The spheres do not affect each other.
What is most likely true about these spheres?
-Both spheres are neutral.
-Both spheres have a positive charge.
-Both spheres have a negative charge.
-One sphere has a positive charge, and the other has a negative charge.
Answer:
both spheres have a positive charge
Which flows through the other?
The mass of this atom is:
u. 3 mass units
b. 4 mass units
c. 6 mass units
d. 7 mass units
e. 11 mass units
Definition:This is a type of lab equipment in which students use probes, interfaces, and software for real-
time data acquisition, display, and analysis with a computer or calculator
What is the term?
Which question is a scientist who studies the genetic engineering of crops most likely attempting to answer?
A. How can a more stable supply of crops be created?
В. How can natural selection create better crops?
С. How can crops be grown without a need for light?
D. How can the genetic variation of crops be increased?
Answer:
i think that it is A
Explanation:
the other ones did not make as much sense
A scientist who studies the genetic engineering of crops most likely attempting how more stable supply of crops be created. so, option A is correct.
What is genetic engineering ?Genetic engineering, often known as genetic alteration, is a technique that modifies an organism's DNA using technology developed in labs. This could entail altering a single base pair (A-T or C-G), erasing a section of DNA, or incorporating a new DNA sequence.
In order to fix genetic flaws and hence prevent or treat hereditary illnesses, gene therapy aims to change specific genes.
The goal of genetic engineering is to alter the genes to increase the organism's capabilities beyond what is typical.
The term "genetic engineering" originally applied to a number of methods for modifying or altering living things through their heredity and reproductive processes.
Thus, option A is correct.
To learn more about genetic engineering follow the link below;
https://brainly.com/question/13491558
#SPJ2
Read the temp what is it?
Can someone please answer this?
Answer:
B) go look on the periodic table for the atomic number
Explanation:
The atomic number is how many protons is in an atom
Answer:
Either A or B
Explanation: Because I learned it on Edge. :)
Convert 812.4 kPa into atm
Answer:
Explanation:
There are a series of unit used to measure PRESSURE. They include millimetre mercury (mmHg), atmospheric pressure (atm), kilopascal etc. These units of measurement are interconvertible i.e. can be changed from one unit to another.
Based on this question asking to convert
1 kilopascal = 0.00986923atm
The actual value for absolute zero in degrees Celsius is −273.15. Use the formula below to determine your percent error for both gas samples.
|experimental value – actual value| x 100
actual value
Please just tell me how to find the experimental value
Answer:
As you noticed, the percent-error formula needs you to use a value in the ... The actual absolute zero is 275C below my coldest recorded value. ... The only way your calculations makes sense is you're trying to calculate how ... Next, I'll interpret "I found that AZ is at -258°C" as "I calculated AZ to be 260 degrees below 2°C".
Explanation:
The experimental error will be 8.95%
Calculating percentage error.The formula used for calculating the percentage error is expressed as:
[tex]\% error=\frac{|exp. \ value - actual \ value|}{actual \ value} \times 100[/tex]
Given the following parameters
Actual value = −273.15 degrees Celcius
Let the experimental value be 300 degrees Celcius (since we are not given)
[tex]\% error=\frac{|300 - 273.15|}{300} \times 100\\\% error=\frac{|26.85|}{300} \times 100\\\% error=8.95\%[/tex]
Hence the experimental error will be 8.95%
Learn more on experimental error here; https://brainly.com/question/2764830
What is the H 2 : H2O molar ratio?
Answer:
The ratio of hydrogen atoms to oxygen atoms used to make water molecules is always 2:1, no matter how many water molecules are being made.
Explanation: