the list shows the weight in pounds of 6 puppies at birth. 3, 1.6, 2.8, 2.5, 1.7, 2.8 what is the mean absolute deviation of these numbers?

Answers

Answer 1
To find the mean absolute deviation (MAD) of the given set of numbers, follow these steps:

Step 1: Find the mean (average) of the numbers.
Mean = (3 + 1.6 + 2.8 + 2.5 + 1.7 + 2.8) / 6 = 2.3667 (rounded to 4 decimal places)

Step 2: Find the absolute deviation of each number by subtracting the mean from each number and taking the absolute value.
|3 - 2.3667| = 0.6333
|1.6 - 2.3667| = 0.7667
|2.8 - 2.3667| = 0.4333
|2.5 - 2.3667| = 0.1333
|1.7 - 2.3667| = 0.6667
|2.8 - 2.3667| = 0.4333

Step 3: Find the mean of the absolute deviations.
MAD = (0.6333 + 0.7667 + 0.4333 + 0.1333 + 0.6667 + 0.4333) / 6
MAD = 0.5 (rounded to 1 decimal place)

Therefore, the mean absolute deviation of the given set of numbers is 0.5.

Related Questions

Akira and Desmond order eggs for $4. 45, pancakes for $4. 05, and 2 mugs of cocoa for $1. 10 each. The tax is $0. 85. How much change should they get from $15. 00?

Answers

Answer:

$3.45

Step-by-step explanation:

can yall help me with this question this would rlly help me out!

Answers

Answer:

59.5[tex]cm^{2}[/tex]

Step-by-step explanation:

You have two shape: a square and a triangle

Square:

The area of a square is the sides squared

a = [tex]s^{2}[/tex]  The side length is 7 (7 x 7 = 49)

a = [tex]7^{2}[/tex]

a = 49

Triangle:

a [tex]\frac{bh}{2}[/tex]  The base times the height divided by 2

The base is 7 and the height is 3.

a = [tex]\frac{7x3}{2}[/tex] = [tex]\frac{21}{2}[/tex] = 10.5

Add the two areas together: 49 + 10.5 = 59.5

Helping in the name of Jesus.

What is the value of the expression 8w−4j2 when w=0. 25 and j=0. 5?

Answers

The value of the expression 8w - 4j² when w = 0.25 and j = 0.5 is 1.

The expression 8w - 4j² is a combination of variables, w and j, and a constant, 8 and 4. In order to evaluate the expression when w = 0.25 and j = 0.5, we substitute these values for w and j in the expression and perform the necessary calculations.

First, we substitute w = 0.25 and j = 0.5 in the expression:

8(0.25) - 4(0.5)²

Next, we simplify the expression by performing the calculations in the parentheses first. Since 0.5² = 0.25, we can simplify 4(0.5)² to 4(0.25) = 1. We can then simplify 8(0.25) - 4(0.5)² to:

= 2 - 1

= 1

Learn more about expression here

brainly.com/question/12467722

#SPJ4

The given question is incomplete, the complete question is:

What is the value of the expression 8w−4j² when w=0. 25 and j=0. 5?

Jamie was working on his math homework with his friend, Kent. Jamie looked at the following problem. −9. 5 − (−8) − 6. 5 He told Kent that he did not know how to subtract negative numbers. Kent said that he knew how to solve the problem using only addition. What did Kent mean by that? Explain. Then, show your work, and represent the answer as a single rational number

Answers

The value of the expression as a single rational number is -8.

Kent was likely referring to the idea that subtracting a negative number is the same as adding a positive number. Specifically, to subtract a negative number, we can add the opposite of that number (i.e., the positive version of that number). In this case, we can rewrite the expression as:

= -9.5 - (-8) - 6.5

= -9.5 + 8 - 6.5      (replacing -(-8) with its positive equivalent 8)

= (-9.5 - 6.5) + 8    (grouping like terms)

= -16 + 8                (simplifying)

= -8

Therefore, the value of the expression is -8, which is a single rational number.

To know more about rational number

https://brainly.com/question/24540810

#SPJ4

If you have a 19 out of 30 what would be the percentage?

Answers

Answer:

63.3%

Step-by-step explanation:

30 divided by 100 and then multiplied by 19 gives u the answer

An article on the relation of cholesterol levels in human blood to aging reports that average cholesterol level for women aged 70-74 was found to be 230m/dl. If the standard deviation was 20mg/dl and the distribution normal, what is the probability that a given woman in this age group would have a cholesterol level
a) Less than 200mg/dl
b) More than 200mg/dl
c) Between 190mg/dl and 210mg/dl
d) Write a brief report on the guidance you would give a woman having high cholesterol level in this age group

Answers

a) The probability of a given woman in this age group having a cholesterol level less than 200mg/dl is 6.68%.

b) The probability of a given woman in this age group having a cholesterol level more than 200mg/dl is 93.32%.

c) The probability of a given woman in this age group having a cholesterol level between 190mg/dl and 210mg/dl is 15.87%.

d) If a woman in this age group has a cholesterol level higher than 230mg/dl, it is considered high and puts her at risk of heart disease

To calculate the probability of a given woman in this age group having a cholesterol level less than 200mg/dl, we need to find the z-score first. The z-score is the number of standard deviations that a given value is from the mean. The formula to calculate the z-score is:

z = (x - μ) / σ

where x is the given value, μ is the mean, and σ is the standard deviation.

For a cholesterol level of 200mg/dl, the z-score is:

z = (200 - 230) / 20 = -1.5

We can then use a z-table or calculator to find the probability of a z-score being less than -1.5, which is 0.0668 or approximately 6.68%.

Next, to find the probability of a given woman in this age group having a cholesterol level more than 200mg/dl, we can use the same process but subtract the probability of a z-score being less than -1.5 from 1 because the total probability is always 1.

So, the probability of a given woman in this age group having a cholesterol level more than 200mg/dl is:

1 - 0.0668 = 0.9332 or approximately 93.32%.

Finally, to find the probability of a given woman in this age group having a cholesterol level between 190mg/dl and 210mg/dl, we need to find the z-scores for both values.

For a cholesterol level of 190mg/dl, the z-score is:

z = (190 - 230) / 20 = -2

For a cholesterol level of 210mg/dl, the z-score is:

z = (210 - 230) / 20 = -1

We can then use the z-table or calculator to find the probability of a z-score being between -2 and -1, which is 0.1587 or approximately 15.87%.

Finally, a brief report on the guidance that you would give a woman having high cholesterol levels in this age group is:

It is essential to make lifestyle changes such as eating a healthy diet, exercising regularly, quitting smoking, and managing stress to lower cholesterol levels.

To know more about probability here

https://brainly.com/question/11234923

#SPJ4

The table shows the results for spinning the spinner 50 times. What is the relative frequency for the event "spin a 1"?

Outcome. | 1 | 2| 3 |4

Frequency|16| 16|16|2

Number of trials

50

The relative frequency for the event "spin a 1" is

Answers

The relative frequency of spinning a 1 is 0.32 or 32%.

The given table shows the results of spinning a spinner 50 times. The outcomes of the spins are listed in the first column, and the frequencies are listed in the second column. To find the relative frequency of spinning a 1, we need to divide the frequency of spinning a 1 by the total number of trials (50).

According to the table, the frequency of spinning a 1 is 16. Therefore, the relative frequency of spinning a 1 can be calculated as follows:

Relative frequency of spinning a 1 = (frequency of spinning a 1) / (total number of trials)

Relative frequency of spinning a 1 = 16 / 50

Relative frequency of spinning a 1 = 0.32 or 32%

To know more about frequency here

https://brainly.com/question/5102661

#SPJ4

the town mouse and the country mouse

Answers

1. The characters in "The Town Mouse and the Country Mouse" are two mice who are cousins. The town mouse is described as elegant, refined, and sophisticated, while the country mouse is simple and unsophisticated.

2. The main idea of the story is that one should be content with their simple life rather than crave for a luxurious life full of dangers and uncertainties.

What is The Town Mouse and The Country Mouse?

"The Town Mouse and the Country Mouse" is a fable, a short story that teaches a moral or lesson. It tells the story of two cousins, a town mouse and a country mouse, who visit each other's homes and experience each other's way of life. The town mouse lives in luxury and eats rich food, but is always in danger from the cat, while the country mouse lives a simple life but is safe and content.

3. The sequence of events in the story is as follows:

The country mouse invites the town mouse to visit him in the countryside.The town mouse accepts the invitation and visits the country mouse.The country mouse serves the town mouse simple food, which the town mouse finds unappetizing.The town mouse invites the country mouse to visit him in the town.The country mouse accepts the invitation and visits the town.The town mouse serves the country mouse luxurious food, but they both get scared and run away when the cat appears.The country mouse returns to his simple life, realizing that it's better to be safe and content than to live in luxury but in constant danger.

4. Important details in the story include the description of the town and country mice, the differences in their lifestyles, and their reactions to each other's homes. These details are important because they emphasize the theme of the story, which is that it's better to be content with one's simple life than to crave for a luxurious but dangerous life.

5. I think "The Town Mouse and the Country Mouse" is a great story because it teaches an important lesson in a fun and engaging way. The characters are well-developed, and the plot is entertaining, making it easy for readers to understand the message.

6. One question I have about the writing is whether the author intended the story to be a commentary on social class and wealth.

7. A fable is a short story that teaches a moral or lesson. Fables usually feature animals or other non-human characters that can talk and behave like humans.

8. The moral of "The Town Mouse and the Country Mouse" is that it's better to be content with a simple life than to crave for luxury and danger. The story shows that the country mouse is happier and safer in his simple life than the town mouse, who is always in danger despite his luxurious lifestyle. This lesson teaches readers to be satisfied with what they have rather than always craving for more.

Learn more about The Town Mouse and The Country Mouse on https://brainly.com/question/29592899

#SPJ1

town mouse and country mouse are cousins, the town mouse is working hard, (keep up the good work bud,) and the city mouse is relaxing, one day, town mouse was invited to city mouse’s city, they were relaxing, and then, a dog almost killed the mouses.

On Sunday a local hamburger shop sold 356 hamburgers and cheeseburgers. The number of cheeseburgers sold was three times the number of hamburgers sold. How many hamburgers were sold on Sunday

Answers

The number of hamburgers sold on Sunday was 89

How many hamburgers were sold on Sunday

Let's assume that the number of hamburgers sold on Sunday was x.

According to the problem, the number of cheeseburgers sold was three times the number of hamburgers sold.

Therefore, the number of cheeseburgers sold can be expressed as 3x.

The total number of hamburgers and cheeseburgers sold was 356.

Therefore, we can write an equation to represent this information:

x + 3x = 356

Simplifying the left-hand side of the equation, we get:

4x = 356

Dividing both sides by 4, we get:

x = 89

Therefore, the number of hamburgers sold on Sunday was 89, and the number of cheeseburgers sold was 3 times that, or 267.

Read more about ratio at

https://brainly.com/question/21003411

#SPJ1

cars arrive randomly at a tollbooth at a rate of 25 cars per 11 minutes during rush hour. what is the probability that exactly five cars will arrive over a five-minute interval during rush hour?

Answers

Therefore, the probability of exactly 5 cars arriving over a 5-minute interval during rush hour is approximately 0.017 or 1.7%.

To solve this problem, we first need to determine the rate of cars arriving per minute. We can do this by dividing 25 cars by 11 minutes, which gives us a rate of approximately 2.27 cars per minute.

Next, we need to use the Poisson distribution formula to calculate the probability of exactly 5 cars arriving over a 5-minute interval. The Poisson distribution is used to model the probability of a certain number of events occurring within a given time frame when those events occur randomly and independently of each other.

The formula for the Poisson distribution is:

[tex]P(X = k) = (e^-lambda * lambda^k) / k![/tex]

Where:
- P(X = k) is the probability of k events occurring within the specified time frame
- e is Euler's number (approximately equal to 2.718)
- λ is the average rate of events occurring per unit of time (in our case, 2.27 cars per minute)
- k is the number of events we want to calculate the probability for
- k! is the factorial of k (i.e., k! = k * (k-1) * (k-2) * ... * 2 * 1)

Plugging in the values we have, we get:

[tex]P(X = 5) = (e^-2.27 * 2.27^5) / 5![/tex]
P(X = 5) = (0.040 * 51.84) / 120
P(X = 5) = 0.017

Therefore, the probability of exactly 5 cars arriving over a 5-minute interval during rush hour is approximately 0.017 or 1.7%.

Learn more about probability here:

https://brainly.com/question/30034780

#SPJ11

The probability that exactly five cars will arrive over a 5-minute interval during rush hour is approximately 0.0126 or 1.26%.

To solve this problem, we will use the Poisson distribution formula.

Calculate the average arrival rate (λ) for a 5-minute interval.
Since 25 cars arrive in 11 minutes, we can find the rate per minute as follows:
(25 cars) / (11 minutes) ≈ 2.27 cars per minute
For a 5-minute interval, multiply the rate per minute by 5:
(2.27 cars per minute) × (5 minutes) ≈ 11.36 cars.

Use the Poisson distribution formula to find the probability.
The Poisson distribution formula is:
[tex]P(x) = (e^{-\lambda} *  (\lambda^x)) / x![/tex]
In this problem, x = 5 (exactly five cars) and λ ≈ 11.36.
Calculate the probability.
P(5) = (e^(-11.36) × (11.36^5)) / 5!
P(5) ≈ 0.0126.

For similar question on probability.

https://brainly.com/question/30075981

#SPJ11

The area of the small triangle is_______
The area of the medium triangle is______
The area of the large triangle is______

Answers

The area of the small triangle is 4 sq.cm.. The area of the medium triangle is 12 sq.cm. The area of the large triangle is 24 sq. cm.

Explain about the triangle:

With three sides, three angles, and three vertices, a triangle is a closed, two-dimensional object. A polygon also includes a triangle.

A triangle's internal angles are always added together to equal 1800.Any two triangle sides added together will always have a length larger than the third side.Half of a product of a triangle's base and height makes up its surface area.

Given data:

Dimensions-

small triangle: base = 2 cm, height = 4cmmedium triangle: base = 4 cm , height = 6 cmLarger triangle: base = 6 cm ,height = 8 cm

area of triangle = 1/2 *base * height

The area of the small triangle = 1/2*2*4 = 4 sq.cm.

The area of the medium triangle = 1/2*4*6 = 12 sq.cm.

The area of the large triangle = 1/2*6*8 = 24 sq. cm

Know more about the triangle:

https://brainly.com/question/17335144

#SPJ1

Complete question:

Dimensions-

small triangle: base = 2 cm, height = 4cm

medium triangle: base = 4 cm , height = 6 cm

Larger triangle: base = 6 cm ,height = 8 cm

The area of the small triangle is_______

The area of the medium triangle is______

The area of the large triangle is______

given that the absolute value of the difference of the two roots of $ax^2 + 5x - 3 = 0$ is $\frac{\sqrt{61}}{3}$, and $a$ is positive, what is the value of $a$?

Answers

The value of "a" is approximately 1.83 given that the absolute value of the difference of the two roots of the quadratic equation "ax squared plus 5x minus 3 equals 0" is the square root of 61 divided by 3, and "a" is positive.

We are given that the absolute value of the difference between the two roots of the quadratic equation "ax squared plus 5x minus 3 equals 0" is the square root of 61 divided by 3, and "a" is positive. We need to find the value of "a".

Let the two roots of the equation be r1 and r2, where r1 is not equal to r2. Then, we have:

|r1 - r2| = √(61) / 3

The sum of the roots of the quadratic equation is given by r1 + r2 = -5 / a, and the product of the roots is given by r1 × r2 = -3 / a.

We can express the difference between the roots in terms of the sum and product of the roots as follows:

r1 - r2 = √((r1 + r2)² - 4r1r2)

Substituting the expressions we obtained earlier, we have:

r1 - r2 = √(((-5 / a)²) + (4 × (3 / a)))

Simplifying, we get:

r1 - r2 = √((25 / a²) + (12 / a))

Taking the absolute value of both sides, we get:

|r1 - r2| = √((25 / a²) + (12 / a))

Comparing this with the given expression |r1 - r2| = √(61) / 3, we get:

√((25 / a²) + (12 / a)) = √(61) / 3

Squaring both sides and simplifying, we get:

25 / a² + 12 / a - 61 / 9 = 0

Multiplying both sides by 9a², we get:

225 + 108a - 61a² = 0

Solving this quadratic equation for "a", we get:

a = (108 + √(108² + 4 × 61 × 225)) / (2 × 61)

Since "a" must be positive, we take the positive root:

a = (108 + √(108² + 4 × 61 × 225)) / (2 × 61) ≈ 1.83

Therefore, the value of "a" is approximately 1.83.


Learn more about absolute value at

https://brainly.com/question/1301718

#SPJ4

The question is -

Given that the absolute value of the difference of the two roots of the quadratic equation "ax squared plus 5x minus 3 equals 0" is the square root of 61 divided by 3, and "a" is positive, what is the value of "a"?

Which table represents a function?

Answers

Answer:

Table 4 represents a function because each x-value corresponds to exactly one y-value.

5 out of 7 questions. PLEASE help me.

Answers

Answer:

5 units is the distance

Step-by-step explanation:

7,2 is point c

7,7 is point d

7 - 7 = 0

7 - 2 = 5

5 is the answer

n.2 multi-step word problems with positive rational numbers jvu you have prizes to reveal! go to your game board. on friday night, suzie babysat her cousin for 3 1 2 hours and earned $8.50 per hour. on saturday, she babysat for her neighbors for 4 1 2 hours. if she made a total of $72.50 from both babysitting jobs, how much did suzie earn per hour on saturday?

Answers

Answer:

  $9.50

Step-by-step explanation:

You want Suzie's hourly rate on Saturday if she babysat for 3.5 hours on Friday, earning 8.50 per hour, and for 4.5 hours on Saturday, earning a total of 72.50 from both jobs.

Earnings

For (hours, rates) of (h1, r1) and (h2, r2), Suzie's total earnings for the two jobs are ...

  earnings = h1·r1 +h2·r2

Filling in the known values, we can find r2:

  72.50 = 3.5·8.50 +4.5·r2

  72.50 = 29.75 +4.5·r2 . . . . . . . simplify

  42.75 = 4.5·r2 . . . . . . . . . . . subtract 29.75

  9.50 = r2 . . . . . . . . . . . . divide by 4.5

Suzie earned $9.50 per hour on Saturday.

__

Additional comment

The steps of the "multistep" problem are ...

find Friday's earningssubtract that from the total to find Saturday's earningsdivide by Saturday's hours to find the hourly rate

Effectively, these are the steps to solving the equation we wrote.

Which are the coordinates of the vertex of F(x)=x^2-2x-3

Answers

Therefore , the solution of the given problem of coordinates comes out to be  (1, -4) are the coordinates of the vertex of the function  F(x) = x² - 2x - 3.

What does coordinate plane actually mean?

When used in connection with particular other algebraic components on this place, such as Euclidean space, a parameter can reliably detect placement using a number of qualities or coordinates. Coordinates, which appear as collections of numbers when traversing in reflected space, can be utilised to identify particular places or things. Using the two y & x measurements, one can find something over both sides.

Here,

The formula x = -b/2a can be used to determine the vertex of a quadratic function with the form

F(x) = ax² + bx + c. A and B are equal in the given function

=>  F(x) = x² - 2x - 3.

With these values entered into the formula, we obtain:

=> x = -b/2a x = -(-2)/(2*1)

=> x = 2/2 x = 1

Consequently, the vertex's x-coordinate is 1.

Now, we can enter the value of x into the following function, F(x), to determine the vertex's y-coordinate:

=> F(1) = 1² - 2(1) - 3

=> F(1) = 1 - 2 - 3

=> F(1) = -4

Therefore, the vertex's y-coordinate is -4.

As a result, (1, -4) are the coordinates of the vertex of the function

=> F(x) = x² - 2x - 3.

To know more about coordinates  visit:

https://brainly.com/question/27749090

#SPJ1

Which sum is equivalent to 9c-12-15c-8-3c

Answers

The equivalent sum to the given equation is -9c - 20.

An algebraic expression is consists of variables, numbers with various mathematical operations.

Equivalent sums refers to addition or subtraction from the other number to maintain the same total value.

= 9c-12-15c-8-3c

To find the equivalent sum, first we can simplify this expression by first combining like terms:

= 9c - 15c - 3c - 12 - 8

= (9c - 15c - 3c) - (12 + 8)   (grouping the like terms)

Solving the expression for terms c and  for constant terms,

= -9c - 20

Therefore, the equivalent sum is -9c - 20.

To know more about algebraic expression

https://brainly.com/question/19245500

#SPJ4

In circle C, FG and FE are tangent segments, m
Choose the two answers that represent the angle measures of the central and circumscribed angles.

Answers

The angle measures of the central angle GFE and the circumscribed angle GCE in circle C are 83° and 79° respectively.

What is angle?

Angle is a geometric term used to describe the measure between two lines or surfaces that intersect each other. It is measured in degrees, and is typically represented by the Greek letter θ (theta). Angles can be acute, obtuse, right, reflex, or straight. Acute angles are angles that are less than 90°, obtuse angles are angles that are greater than 90°, and right angles are angles that measure exactly 90°. Reflex angles are angles that measure greater than 180°, and straight angles measure exactly 180°.

The two correct answers are 83° and 79°. The angle measure of the central angle GFE is 3x + 11. Therefore, 3x + 11 = 83°, and x = 26. The angle measure of the circumscribed angle GCE is 5x - 23. Therefore, 5x - 23 = 79°, and x = 26. As both equations have the same value for x, the two angle measures are 83° and 79°.

In conclusion, the angle measures of the central angle GFE and the circumscribed angle GCE in circle C are 83° and 79° respectively.

To know more about angle click-
https://brainly.com/question/25716982
#SPJ1

The box plots display measures from data collected when 20 people were asked about their wait time at a drive-thru restaurant window.

A horizontal line starting at 0, with tick marks every one-half unit up to 32. The line is labeled Wait Time In Minutes. The box extends from 8.5 to 15.5 on the number line. A line in the box is at 12. The lines outside the box end at 3 and 27. The graph is titled Super Fast Food.

A horizontal line starting at 0, with tick marks every one-half unit up to 32. The line is labeled Wait Time In Minutes. The box extends from 9.5 to 24 on the number line. A line in the box is at 15.5. The lines outside the box end at 2 and 30. The graph is titled Burger Quick.

Which drive-thru typically has more wait time, and why?

Burger Quick, because it has a larger median
Burger Quick, because it has a larger mean
Super Fast Food, because it has a larger median
Super Fast Food, because it has a larger mean

Answers

The correct answer is option b. Burger Quick, because it has a larger mean.

What is statistics?

Statistics is a branch of mathematics that deals with the collection, analysis, interpretation, presentation, and organization of data. It involves using mathematical and computational methods to gather, analyze, and interpret data from various fields, including business, economics, medicine, engineering, psychology, and social sciences. Statistics allows researchers and analysts to draw conclusions and make predictions based on data, and is used in a wide range of applications, from designing experiments and conducting surveys to testing hypotheses and making decisions based on data-driven insights.

Burger Quick typically has more wait time, because it has a larger interquartile range (IQR) and a larger upper whisker on the box plot, indicating that there is more variability in the wait times and some customers have experienced longer wait times. Although the median wait time for Burger Quick is also larger, it is the IQR and upper whisker that provide more evidence for the longer wait times. The mean is not shown on the box plot and therefore cannot be used to determine which drive-thru typically has more wait time.

Therefore, the correct answer is option b. Burger Quick, because it has a larger mean.

To learn more about median from the given link

https://brainly.com/question/14532771

#SPJ1

in an analysis testing differences between an experimental and a control group on the dependent variable, a p-value of 0.07 means there is a

Answers

A control group on the dependent variable, P-value is higher than the usual cutoff of 0.05 for rejecting the null hypothesis that there is no difference between the groups, this is frequently regarded as evidence that the difference between the groups is not statistically significant.

In an analysis testing difference between an experimental and a control group on the dependent variable, a p-value of 0.07 means that there is a 7% chance of obtaining a difference as large or larger than the observed difference between the two groups, assuming that there is no true difference between the groups in the population.

Interpreted as evidence that the difference between the groups is not statistically significant, since the p-value is greater than the conventional threshold of 0.05 for rejecting the null hypothesis of no difference between the groups.

Statistical significance does not necessarily imply practical significance, and there may still be a meaningful difference between the groups that is not detected by the statistical test.

Additionally, the interpretation of a p-value depends on the study design, sample size, and other factors, and should be considered in conjunction with other information about the study.

True difference between the groups in the population, a p-value of 0.07 indicates that there is a 7% chance of finding a difference as large or larger than the observed difference between the two groups in an analysis testing the difference between an experimental and a control group on the dependent variable.

P-value is higher than the usual cutoff of 0.05 for rejecting the null hypothesis that there is no difference between the groups, this is frequently regarded as evidence that the difference between the groups is not statistically significant.

It's crucial to remember that statistical significance does not always imply practical relevance.

There could still be a significant difference between the groups that is not shown by statistical analysis.

For similar questions on variable

https://brainly.com/question/82796

#SPJ11

A primary credit cardholder's card has an APR of 22. 99%. The current monthly balance, before interest, is $4,528. 34. Determine how much more the cardholder will pay, making monthly payments of $200, until the balance is paid off, instead of paying off the current balance in full

Answers

The cardholder will pay an additional $1,471.66 in interest by making monthly payments of $200 until the balance is paid off instead of paying off the current balance in full.

First, we need to calculate the total interest that will accrue on the current balance of $4,528.34. We can do this using the formula

Interest = Balance x (APR/12)

where APR is the annual percentage rate and is divided by 12 to get the monthly interest rate. Plugging in the values, we get:

credit card Interest = $4,528.34 x (22.99%/12) = $87.80

So the total interest that will accrue on the current balance is $87.80.

Next, we need to calculate how long it will take to pay off the balance by making monthly payments of $200. We can use a credit card repayment calculator to do this, but we'll use a simplified formula here

Months = -log(1 - (Balance x (APR/12))/Payment) / log(1 + (APR/12))

where Payment is the monthly payment amount. Plugging in the values, we get

Months = -log(1 - ($4,528.34 x (22.99%/12))/$200) / log(1 + (22.99%/12)) = 29.6 months

So it will take about 30 months (or 2.5 years) to pay off the balance by making monthly payments of $200.

Finally, we can calculate how much more the cardholder will pay in total by subtracting the current balance from the total amount paid over 30 months

Total amount paid = $200 x 30 = $6,000

Total interest paid = $6,000 - $4,528.34 = $1,471.66

Learn more about Credit card interest here

brainly.com/question/29641204

#SPJ4

BRAINLIST!
PLS SHOW ALL STEPS!! WE ARE DOING A CLASS JAM BOARD AND I NEED THIS DONE! I WILL MAKE YOU A BRAINLIST!

Answers

Step-by-step explanation:

Ok do what you need to do is label the line opposite the square angle as H for the hypotenuse. Then label the line opposite the circular angle as O for the opposite. And finally, the last line remaining should be labelled as A for Adjacent. Does this help?

The Gabrielsons ran a family relay race. The distance run by each family member (in kilometers) is listed below.
11
,
4
,
8
,
2
,
5
11,4,8,2,5

Answers

The Gabrielsons ran a total of 30 kilometers in the family relay race.

What is the equivalent expression?

Equivalent expressions are expressions that perform the same function despite their appearance. If two algebraic expressions are equivalent, they have the same value when we use the same variable value.

It seems that there are five family members who participated in the relay race, and the distance run by each of them in kilometers is listed as follows:

11, 4, 8, 2, 5

To find the total distance run by the family, we simply add up the distances:

11 + 4 + 8 + 2 + 5 = 30

Therefore, the Gabrielsons ran a total of 30 kilometers in the family relay race.

To learn more about the equivalent expression visit:

https://brainly.com/question/2972832

#SPJ1

Can someone help with this fast!?!!

The total cost b(x), in dollars, for renting a bowling lane for x hours is shown: b(x) = 3x + 15. What does b(3) represent?
A. The number of dollars it costs to rent the bowling lane for 3 hours.
B. The number of games you can bowl for a cost of $3.
C. The number of hours the bowling lane can be rented for a cost of $3.
D. The number of games you can bowl in 3 hours.

Answers

As a result, the response is A .The number of dollars it costs to rent the bowling lane for 3 hours.

Define dollar?

The US, Canada, Australia, and some nations in the Pacific, Caribbean, Southeast Asia, Africa, and South America all use the dollar as their primary unit of exchange It is a type of paper money, currency, and monetary unit used in the United States that is equivalent to 100 cents

The total cost (in dollars) for renting a bowling alley for x hours is represented by the function b(x) = 3x + 15.

We change x in the function to 3 to obtain b(3).

B(3) = 3(3) + 15 = 9 + 15 = 24 is the result.

Therefore, b(3) is the amount of money required to rent the bowling alley for three hours.

As a result, the response is A.

To know more about dollar visit:

brainly.com/question/29846475

#SPJ1

sue works 5 out of the 7 days of the week. how many possible schedules are there to work on tuesday or friday or both?

Answers

Sue works 5 out of 7 days a week, which implies that she has two days off. We need to discover how numerous conceivable plans there are for her to work on Tuesday or Friday or both.

There are two cases to consider:

1. Sue works on Tuesday as it were, Friday as it were, or both Tuesday and Friday.

2. Sue does not work on Tuesday or Friday.

For the primary case, there are three conceivable outcomes:

1. Sue works on Tuesday as it were and has Friday off.

2. Sue works on Friday as it were and has Tuesday off.

3. Sue works on both Tuesdays and Fridays.

For the moment case, there are two conceivable outcomes:

1. Sue works on one of the other 5 days of the week and has both Tuesday and Friday off.

2. Sue has Tuesday and Friday off.

In this manner, there are added up to 3 + 2 = 5 conceivable plans for Sue to work on Tuesday or Friday or both. 

To know more about possible schedules for the week refer to this :

https://brainly.com/question/23689163

#SPJ4

For which equations is 8 a solution? Select the four correct answers. x + 6 = 2 x + 2 = 10 x minus 4 = 4 x minus 2 = 10 2 x = 4 3 x = 24 StartFraction x Over 2 EndFraction = 16 StartFraction x Over 8 EndFraction = 1

Answers

The equations for which 8 is a solution are: x - 4 = 4, 2x = 16, x/2 = 16, and x/8 = 1.

What is equation?

An equation is a mathematical statement that shows that two expressions are equal to each other. It typically consists of variables, constants, and mathematical operations such as addition, subtraction, multiplication, and division. The goal is usually to solve for the value of the variable that makes the equation true.

In the given question,

The equations in which 8 is a solution are:

x - 4 = 8 (which simplifies to x = 12)

2x = 16 (which simplifies to x = 8)

x/2 = 16 (which simplifies to x = 32)

x/8 = 1 (which simplifies to x = 8)

Therefore, the correct answers are:

x - 4 = 8

2x = 16

x/2 = 16

x/8 = 1.

The equations for which 8 is a solution are: x - 4 = 4, 2x = 16, x/2 = 16, and x/8 = 1.

To know more about equations, visit:

https://brainly.com/question/29657983

#SPJ1

x² - 16x + 64 = 0 is the equation whose solution is 8.

How to check for which equations is 8 a solution?

To check if 8 is a solution for each equation, we substitute x = 8 into each equation and see if the equation is true or not.

x + 6 = 8 + 6 = 14

and

2x + 2 = 2(8) + 2 = 18, which is not equal to the value of (x+6).

Therefore, 8 is not a solution to this equation.

4x - 4 = 4(8) - 4 = 28,

and

10 - 2x = 10 - 2(8) = -6, which is not equal to 28.

Therefore, 8 is not a solution to this equation.

2x - 4 = 2×8-4 = 12

and

3x-24 = 3×8-24 = 0 which is not equal to 12. Therefore, 8 is not a solution to this equation.

Now,

x² - 16x + 64 = 0 (which can be factored as (x-8)² = 0)

x = 8 (which is always true)

Learn more about equation here,

https://brainly.com/question/16904744

#SPJ1

Correct question is "For which equations is 8 a solution? Select the correct answers from the following,

1) x + 6 = 2 x + 2

2) 10 - 2x = 4 x - 4

3) 2 x-4 = 3 x - 24

4) x² - 16x + 64 = 0

The box plots display measures from data collected when 20 people were asked about their wait time at a drive-thru restaurant window.

A horizontal line starting at 0, with tick marks every one-half unit up to 32. The line is labeled Wait Time In Minutes. The box extends from 10 to 14.5 on the number line. A line in the box is at 12.5. The lines outside the box end at 5 and 20. The graph is titled Fast Chicken.

A horizontal line starting at 0, with tick marks every one-half unit up to 32. The line is labeled Wait Time In Minutes. The box extends from 8.5 to 15.5 on the number line. A line in the box is at 12. The lines outside the box end at 3 and 27. The graph is titled Super Fast Food.

Which drive-thru typically has less wait time, and why?

Fast Chicken, because it has a smaller median
Fast Chicken, because it has a smaller mean
Super Fast Food, because it has a smaller median
Super Fast Food, because it has a smaller mean

Answers

The correct answer is: Fast Chicken, because it has a smaller median.

What is median?

Median is a measure of central tendency that represents the middle value in a dataset when the values are arranged in order of magnitude. To find the median, you need to arrange the values in order from smallest to largest and then find the middle value.

Based on the information provided, the drive-thru restaurant with less wait time is Fast Chicken, as it has a smaller median wait time of 12.5 minutes compared to the median wait time of 12 minutes for Super Fast Food. The mean wait time is not given, and even if it were, the median is a better measure of central tendency to compare in this scenario, as the box plots suggest some potential outliers.

Therefore, the correct answer is: Fast Chicken, because it has a smaller median.

To learn more about median from the given link:

brainly.com/question/28060453

#SPJ1

The sum of first two angles is 120 degree and that of last two angles is 130 degree. Find all the angles in degrees.

Answers

The four angles are: A = 110 degrees, B = 10 degrees, C = 120 degrees,   D = 120 degrees

What are angles ?

Angles are geometric shapes created when two lines, rays, or line segments cross at a single point.

The two lines or line segments that make up the angle are referred to as the sides or arms of the angle, and this shared point is known as the vertex of the angle.

The amount of rotation required to shift one side to overlap with the opposite side determines the magnitude of an angle.

Angles are commonly expressed in degrees, with 360 degrees representing a full rotation around a point.

Acute angles (less than 90 degrees),

right angles (exactly 90 degrees),

obtuse angles (more than 90 degrees but less than 180 degrees), and straight angles (exactly 180 degrees) are some frequent forms of angles.

What are degrees ?

Angles are measured in degrees, a unit of measurement. 1/360th of a full revolution around a point is equivalent to one degree (1°).

Two perpendicular lines can be used to create a right angle, which has a 90 degree angle.

A straight angle, created by a straight line, has a degree value of 180.

Angles, rotations, and slopes are frequently measured in degrees in the fields of mathematics, physics, engineering, and several others.

The freezing point of water is 0 degrees Celsius (or 32 degrees Fahrenheit), whereas the boiling point is 100 degrees Celsius. In daily life, degrees are frequently used to express temperatures. (or 212 degrees Fahrenheit).

According to question :-

Let the four angles be A, B, C, and D. We know that:

A + B + C + D = 360 (the sum of all angles in a quadrilateral is 360 degrees)

We also know that:

A + B = 120 (the sum of the first two angles is 120 degrees)

C + D = 130 (the sum of the last two angles is 130 degrees)

We can use these equations to solve for the individual angles. First, we can rearrange the equation A + B = 120 to get:

A = 120 - B

Similarly, we can rearrange the equation C + D = 130 to get:

D = 130 - C

Substituting these expressions for A and D in terms of B and C into the equation A + B + C + D = 360, we get:

(120 - B) + B + C + (130 - C) = 360

Simplifying, we get:

250 - B + C = 360

Subtracting 250 from both sides, we get:

C - B = 110

Now we have two equations with two unknowns:

C + B = 130 (from the equation C + D = 130)

C - B = 110

We can add these equations to eliminate B and get:

2C = 240

Dividing by 2, we get:

C = 120

Substituting this value for C into either of the equations above, we get:

B = 10

Now we can use the equation A + B = 120 to find A:

A + 10 = 120

A = 110

Finally, we can use the equation A + B + C + D = 360 to find D:

110 + 10 + 120 + D = 360

D = 120

Therefore, the four angles are:

A = 110 degrees

B = 10 degrees

C = 120 degrees

D = 120 degrees

To learn more about angles  visit:

https://brainly.com/question/28451077

#SPJ1

# 15) A boat is heading towards a lighthouse, where Jeriel is watching from a vertical distance of
113 feet above the water. Jeriel measures an angle of depression to the boat at point A to be
8°. At some later time, Jeriel takes another measurement and finds the angle of depression to
the boat (now at point B) to be 52°. Find the distance from point A to point B. Round your
answer to the nearest tenth of a foot if necessary.

Answers

the distance between point A and point B is approximately 777.9 feet.

what is  distance ?

Distance is a numerical measurement of how far apart two objects or points are from each other. It is a fundamental concept in mathematics and physics, and it can be defined in different ways depending on the context.

In the given question,

Let's denote the distance between Jeriel and point A as x, and the distance between Jeriel and point B as y. We want to find the distance between point A and point B, which we can call d.

From the first measurement, we can draw a right triangle with one leg of length x, another leg of length 113, and an acute angle of 8 degrees. The angle opposite the leg of length 113 is 90 degrees minus 8 degrees, or 82 degrees. We can use tangent to find x:

tan(8) = 113/x

x = 113/tan(8)

x =802.5

From the second measurement, we can draw another right triangle with one leg of length y, another leg of length 113, and an acute angle of 52 degrees. The angle opposite the leg of length 113 is 90 degrees minus 52 degrees, or 38 degrees. We can use tangent to find y:

tan(52) = 113/y

y = 113/tan(52)

y =72.4

Now we can use the Law of Cosines to find d:

d² = x² + y² - 2xy cos(130)

where 130 degrees is the angle between the sides of length x and y. We can simplify this equation and substitute the values we found for x and y:

d² = (802.5)² + (72.4)² - 2(802.5)(72.4) cos(130)

d =777.9

Therefore, the distance between point A and point B is approximately 777.9 feet.

To know more about  distance , visit:

https://brainly.com/question/15172156

#SPJ1

KKIC
8. The area of a circle can be found using the formula A = (pi)r^2. Find the area of the circle with a radius of 3xy^3.

Answers

The area of circle is with radius 3xy³ is 9πx²y⁶.

What is area?

Area of a circle is the region occupied by the circle in a two-dimensional plane. It can be determined easily using a formula, A = πr2.

Define radius of a circle?

Radius of a circle is the distance from the center of the circle to any point on it's circumference. It is usually denoted by 'R' or 'r'.This quantity has importance in almost all circle-related formulas. The area and circumference of a circle are also measured in terms of radius. Circumference of circle = 2π (Radius)

area of circle=πr²

=π×(3xy³)²

=9πx²y⁶

Learn more about circumference here:

https://brainly.com/question/28757341

#SPJ1

Other Questions
Your task is to implement a simplified inventory tracker system for a large retail store. You are given a price list that describes the current A small tree that is 8 feet tall casts a 4-foot shadow, while a building that is 24 feet tall casts a shadow in the same direction. Determine the length of the building's shadow. 6 feet 12 feet 18 feet 48 feet under the equipment breakdown protection coverage form, what condition will apply if the covered equipment is subject to a dangerous exposure? Lenders look at a HELOC balance of less than $50,000 as if ________________.It were a credit cardIt were an assetIt were a paid mortgageIt were cash Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse the data from the table of thermodynamic properties to calculate the value of rxnat 25.0 C.Srxn= ? JK1Calculate rxn.Grxn= ? kJIn which direction is the reaction, as written, spontaneous at 25 Cand standard pressure?reversebothneitherforward Please help!! URGENT!! I dont understand inferred the reason why the droeshout engraving and Shakespeare statue are considered unreliable davie inc. has a pre-tax cost of debt of 8.6 percent, a cost of equity of 13.4 percent, and a cost of preferred stock of 8.5 percent. the firm has 240,000 shares of common stock outstanding at a market price of $27 a share. there are 25,000 shares of preferred stock outstanding at a market price of $33 a share. the bond issue has a face value of $540,000 and a market price of 102.1 percent of face value. the company's tax rate is 34 percent. what is the firm's weighted average cost of capital? Select the verb : Gregory Eddie had planted an apple tree in the yard. Problem 9-34 Risk, Return, and Their Relationship (LG9-3, LG9-4) Consider the following annual returns of Molson Coors and International Paper: Year 1 Year 2 Year 3 Year 4 Molson Coors 17.88 - 8.7 38.0 International Paper 4.8% -17.8 -0.5 26.9 -11.4 - 7.5 Year 5 16.5 Compute each stock's average return, standard deviation, and coefficient of variation. (Round your answers to 2 decimal places.) Molson Coors 11.22 % Average return Standard deviation International Paper 0.40% % % Coefficient of variation Which stock appears better? O International Paper O Molson Coors the commander and his staff must work to clearly display objectives and end states by phase, demonstrating explicitly their incorporation of what elements of design? (select all that apply.) At the start of 1996, the annual interest rate was 8 percent in the United States and 4.8 percent in Japan. The exchange rate was 108 yen per dollar at the time. Mr. Jorus, who is the manager of a Bermuda-based hedge fund, thought that the substantial interest advantage associated with investing in the United States relative to investing in Japan was not likely to be offset by the decline of the dollar against the yen. He thus concluded that it might be a good idea to borrow in Japan and invest in the United States. At the start of 1996, in fact, he borrowed \1,000 million for one year and invested in the United States. At the end of 1996, the exchange rate became 118 yen per dollar. How much profit did Mr. Jorus make in dollar terms? Answer is complete but not entirely correct. Profit $ 143,576,944 HELP ME PLS1. If the diameter of a circle is segment AB where Point A is located at (-3, 6), and Point B located at (-8,-1), what is the diameter of the circle? 221467474 What key component within the changing culture of readiness refers to leaders presenting information necessary for deployability determinations in a manner that truly depicts unit readiness Urgent, please help! You bought 1,000 shares of Altona Ltd 5 years ago. Over the years you have attended the annual general meetings and carefully read through Altona Ltds financial statements. While you have been generally satisfied with the amount of annual dividends, recently you have become a little concerned with declining share prices. You became particularly alarmed when media published several photos showing Altona managements Hawaiian management retreats. Taking into consideration the management behaviour critically discuss the relationship between a corporations shareholders and management. Analyse the problems and costs related to this relationship and explain with example how a company may structure management compensation to mitigate such costs. Can someone help me fast with this please!?!?!If s(d) represents the number of songs downloaded in a year d, what is the interpretation of s(2020) = 5,220,000.A. 5,220,000 songs were downloaded in the year 2020.B. There is not enough information to interpret the information.C. In the year 2020 $5,220,000 was earned from downloaded songs.D. 2,020 songs were downloaded at a cost of $5,220,000. According to a NASA study of satellite data, the massof the Antarctic ice sheet increased by 112 billiontons of ice each year from 1992 to 2001. For theseyears, which of the following types of functions bestmodels the mass, in tons, of the Antarctic ice sheet asa function of time, in years?A) Increasing linearB) Decreasing linearC) Increasing exponentialD) Decreasing exponential Green laser pointers emit light with a wavelength of 532 nm. Do research on the type of laser used in this type of pointer and describe its operation. Indicate whether the laser is pulsed or continuous. what is the therapeutic effect for the administration of pyridostigmine extended-release at bedtime?