Answer:
0.065 meters
Explanation:
Answer:
Start by dividing the length value by 1000, so that would be
65 / 1000 = 0.065 meters
6th grade science Major grade plz help ASAP
Answer: An organism is part of a community
What is the temperature
Answer:
I think it mught be 12.9?
Answer:
the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9
hope it is helpful to you
Krupton (Kr) is a
A. Gas
B. Metal
C. Non of these
D. Metalloid
Answer: C. None of these
Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?
inches
Answer:
f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq
Explanation:
What is a reducing agent?
Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.
CREDIT: Wikipedia
Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.
Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.
How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?
Answer:
this should help
Explanation:
How many particles are in a 34 g sample of Al2(SO4)3?
please help!
Answer:
5.98 × 10^22 particles
Explanation:
To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)
The mass of Al2(SO4)3 given in this question is as follows: 34grams.
To convert this mass value to moles, we use;
Mole = mass/molar mass
Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3
= 54 + (32 + 64)3
= 54 + 288
= 342g/mol
mole (n) = 34/342
n = 0.0994mol
number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23
= 0.598 × 10^23
= 5.98 × 10^22 particles
how atoms form chemical bond discuss in detail
Answer:
Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.
___ SeCl6 + ___ O2 --> ___ SeO2 + ___ Cl2
What is the balanced equation for these reactions?
I give Brainliest! Please no links
Answer:
SeCl₆ + O₂ → SeO₂ + 3Cl₂
Explanation:
Unbalanced:
SeCl₆ + O₂ → SeO₂ + Cl₂
Count the atoms.
On the left side, we have 1 Se atom, 6 Cl atoms, and 2 O atoms.
On the right side, we have 1 Se atom, 2 O atoms, and 2 Cl atoms.
So everything is balanced except for Cl. To balance, we put a 3 coefficient in front of Cl₂.
SeCl₆ + O₂ → SeO₂ + 3Cl₂
c:
2. What percentage of the offspring
will have the red flowers?
Answer:
1/4 of the offspeing will have the red flowers
You are given three liquids. You know that one of them is a suspension, one is a solution with nonelectrolytes, and the other is a solution with electrolytes. Describe the process by which you would differentiate between the three.
Answer:
decant/ filter then decompose the electrolytes by electrolysis
Explanation:
Differentiation of suspension solution is done by filtering and differentiation of electrolyte and non-electrolyte solution is done by electrolysis process.
What is electrolysis process?Electrolysis process is used to decompose the any electrolyte present in any solution into their constitute ions towards the cathodes and anodes under the electric flow of current.
Process which is required to differentiate suspension solution is filtering, because in this solution suspended insoluble particles are present which get filtered. Now to differentiate between non electrolyte and electrolyte solution we will use the electrolysis process, as non electrolyte solution do not show any behavior in this.
Hence, we use filtering and electrolysis process for the differentiation.
To know more about electrolysis, visit the below link:
https://brainly.com/question/25712870
If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?
Answer:
Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.
Explanation:
What factor determines whether an acid or base is strong or weak?
A)The number of hydroxide ions.
B)The number of hydronium ions.
C)The extent to which the acid or base ionizes.
Answer:
i think it's c
Explanation:
Which question is a scientist who studies the genetic engineering of crops most likely attempting to answer?
A. How can a more stable supply of crops be created?
В. How can natural selection create better crops?
С. How can crops be grown without a need for light?
D. How can the genetic variation of crops be increased?
Answer:
i think that it is A
Explanation:
the other ones did not make as much sense
A scientist who studies the genetic engineering of crops most likely attempting how more stable supply of crops be created. so, option A is correct.
What is genetic engineering ?Genetic engineering, often known as genetic alteration, is a technique that modifies an organism's DNA using technology developed in labs. This could entail altering a single base pair (A-T or C-G), erasing a section of DNA, or incorporating a new DNA sequence.
In order to fix genetic flaws and hence prevent or treat hereditary illnesses, gene therapy aims to change specific genes.
The goal of genetic engineering is to alter the genes to increase the organism's capabilities beyond what is typical.
The term "genetic engineering" originally applied to a number of methods for modifying or altering living things through their heredity and reproductive processes.
Thus, option A is correct.
To learn more about genetic engineering follow the link below;
https://brainly.com/question/13491558
#SPJ2
What is one thing that is the same about a mole of sodiums and a mole of carbons?
A) The weight
B) All of these
C) The total number of atoms
D) The mass
If you want to change the type of element your atom is, you can either
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron
Answer:
Add a proton and add a neutron
Which of the answers does not represent a common type of air pollution? A) agricultural ammonia B) carbon monoxide exhaust C) sulfur oxide D) synthetic organic compounds E) industrial nitrogen oxide
Answer:
D)
synthetic organic compounds
Explanation:
synthetic organic compounds are water pollutants
do weight loss Subliminals work?
Answer:
Some early research suggests that subliminal messages may influence food- and diet-related thoughts and behaviors. However, other research has found that subliminal messages with weight loss cues have no effect.
Explanation:
Convert 16.8 L of nitrogen monoxide gas at STP to grams .
1.What is the coefficient of the scientific notation answer ?
2.What is the exponent of the scientific notation answer ? 3.How many significant figures are there in the answer?
4.What is the right most significant figure in the answer ?
Convert 12.5 grams of fluorine gas at STP to L.
1.What is the coefficient of the scientific notation answer? 2.What is the exponent of the scientific notation answer? 3.How many significant figures are there in the answer ?
4.What is the right most significant figure in the answer?
Answer:
See explanation
Explanation:
1 mole of a gas occupies 22.4 L
x moles occupies 16.8 L
x = 1 mole * 16.8 L/22.4 L
x = 0.75 moles
number of moles = mass/molar mass
mass = number of moles * molar mass
mass = 0.75 moles * 30.01 g/mol = 22.5075 g = 2.25 * 10^1 g
the coefficient of the scientific notation answer = 2.25
the exponent of the scientific notation answer = 1
significant figures are there in the answer = 6
the right most significant figure in the answer = 3
2.
number of moles = 12.5g/38g/mol = 0.3289 moles
1 mole occupies 22.4 L
0.3289 moles occupies 0.3289 moles * 22.4 L/1 mole
= 7.36736 L = 7.36736 * 10^0 L= 7.37 * 10^0 L
the coefficient of the scientific notation answer =7.37
the exponent of the scientific notation answer = 0
significant figures are there in the answer = 6
the right most significant figure in the answer= 3
Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?
How many molecules are in 8.2 moles of water,H2o
Answer:
4.938×10^24 molecules
Explanation:
a mole is 6.023×10^23
(8.2)×(6.023×10^23)=4.938×10^24
____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?
Answer:
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Explanation:
The valency of K element is + 1 while that of PO4 compound is -3
Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.
Hence, the revised equation will be
H3PO4 + 3KOH ----> K3PO4 + 3H2O
Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.
Read the temp what is it?
How can water affect the rock cycle?
Water can cause rocks to break into sediments through mechanical weathering.
Water can cause rocks to be buried deep underground.
Water can cause rocks to melt.
Water can causer rocks to break into sediments through chemical weathering.
Answer:
b
Explanation:
b because it's a physical change
How are stoichiometric calculations performed for redox reactions?
Answer:
(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion
Explanation:
According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.
During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.
Using the human species as an example, explain why physical appearance or morphology is NOT always useful for identifying organisms belonging to the same species.
Answer:
Get SNS
Explanation:
which system does the endocrine gland influence to fight infections
Answer:
Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops
Pick one answer do not put any links please
Complete the missing information in the reactions. Then, label the reaction one of the following:
Alpha Decay
Electron Capture
Beta Decay
Positron Emission
.
14
N +
0
Type:
238
92
234
90
Th +
Type:
15
0
15
N +
7
Type:
8
0
32
15
Type:
105
Ag +
47
105
Pd
46
Type:
40
Type:
20
I
244
94 Pu -
Type: :