All help is appreciated thank you.

All Help Is Appreciated Thank You.

Answers

Answer 1

Using the fact that the triangles are similar we can see that the value of x is  36

How to find the value of x?

We can see that the triangles are similar due to the same interior angles, then ther is a scale factor k between them.

So we can write:

20*k = 48

k = 48/20 = 2.4

Then:

x = 15*2.4

x = 36

That is the value of x.

Learn more about similar triangles at:

https://brainly.com/question/14285697

#SPJ1


Related Questions

You roll a six sided die 30 times. A 5 is rolled 8 times. What is the theoretical probability of rolling a 5? What is the experimental probability of rolling a 5?

Answers

The theoretical and experimental probability of rolling a 5 are 1/6 and 4/15 respectively.

How do we derive the probability?

We will calculate the theoretical probability by substituting 30 for the number of favorable outcomes as the die is rolled 30 times with one option each for 30 rolls and 180 for total number of outcomes in theoretical probability formula.

P(Theoretical probability of rolling a 5) = 30/180

P(Theoretical probability of rolling a 5) = 1/6.

The experimental probability is calculated by substituting 8 for the number of time the event occurs and 30 for the total number of trials.

P(Experimental probability of rolling a 5)= 8/30

P(Experimental probability of rolling a 5) =4/15

Read more about probability

brainly.com/question/24756209

#SPJ1

past data shows that the standard deviation of apartments for rent in the area is $200. suppose we want a 98% confidence interval with margin of error of 50. what sample size do we need?

Answers

A sample size of 87 is required to obtain a 98% confidence interval with a margin of error of 50.

How to calculate sample size?

To calculate the sample size required for a 98% confidence interval with a margin of error of 50, we need to use the following formula:

n = [Z*(σ/ME)]^2

where:

n = the sample size needed

Z = the Z-score for the desired confidence level (98% or 2.33)

σ = the standard deviation of apartments for rent in the area ($200)

ME = the margin of error ($50)

Plugging in the given values, we get:

n = [2.33*(200/50)]^2

n = [9.32]^2

n ≈ 86.7

Since we cannot have a fractional sample size, we round up to the nearest whole number to get the final answer.

Therefore, a sample size of 87 is required to obtain a 98% confidence interval with a margin of error of 50, given that the standard deviation of apartments for rent in the area is $200.

Learn more about sample size

brainly.com/question/30885988

#SPJ11

A bottle of water that is 80°F is placed in a cooler full of ice. The temperature of the water decreases by 0. 5°F every minute. What is the temperature of the water, in degrees Fahrenheit, after 5 1/2
minutes? Express your answer as a decimal

Answers

After 5 and a half minutes, the temperature of the water will be 77°F.

In this scenario, we are given that the initial temperature of the water is 80°F. We also know that the temperature of the water decreases by 0.5°F every minute. We want to find out what the temperature of the water will be after 5 and a half minutes.

To solve this problem, we need to use a bit of math. We know that the temperature of the water is decreasing by 0.5°F every minute. So after 1 minute, the temperature of the water will be 80°F - 0.5°F = 79.5°F. After 2 minutes, the temperature will be 79.5°F - 0.5°F = 79°F. We can continue this pattern to find the temperature after 5 and a half minutes.

After 5 minutes, the temperature of the water will be 80°F - (0.5°F x 5) = 77.5°F. And after another half minute (or 0.5 minutes), the temperature will decrease by another 0.5°F, so the temperature will be 77.5°F - 0.5°F = 77°F.

To know more about temperature here

https://brainly.com/question/11464844

#SPJ4

Solve for x. -7.6 -1.2 + X 0.5​

Answers

To solve for x, we need to simplify the expression first by adding the numbers on the left side and right side of the equation:

-7.6 - 1.2 + x = 0.5

Adding -7.6 and -1.2, we get:

-8.8 + x = 0.5

Now we can isolate x by adding 8.8 to both sides of the equation:

-8.8 + x + 8.8 = 0.5 + 8.8

Simplifying, we get:

x = 9.3

Therefore, the solution for x in the equation -7.6 - 1.2 + x = 0.5 is x = 9.3.

Write the functions in standard form:
h(x)=2(x-3)²-9
h(x)=
p(x) = -5(x + 2)² + 15
p(x)=

Answers

Answer:

[tex]h(x)=2x^2-12x+9[/tex],  [tex]p(x)=-5x^2-20x-5[/tex]

Step-by-step explanation:

To get to the standard form of a quadratic equation, we need to expand and simplify. Recall that standard form is written like so:

[tex]ax^2+bx+c[/tex]

Where a, b, and c are constants.

Let's expand and simplify h(x).

[tex]2(x-3)^2-9=\\2(x^2+9-6x)-9=\\2x^2+18-12x-9=\\2x^2+9-12x=\\2x^2-12x+9[/tex]

Thus, [tex]h(x)=2x^2-12x+9[/tex]

Let's do the same for p(x).

[tex]-5(x+2)^2+15=\\-5(x^2+4+4x)+15=\\-5x^2-20-20x+15=\\-5x^2-5-20x=\\-5x^2-20x-5[/tex]

Thus, [tex]p(x)=-5x^2-20x-5[/tex]

A rectangular prism is shown in the image.

A rectangular prism with dimensions of 5 yards by 5 yards by 3 and one half yard.

What is the volume of the prism?

twenty eight and one half yd3
forty one and one fourth yd3
eighty seven and one half yd3
166 yd3

Answers

The volume of the prism is 87 and 1/2 cubic yards or 87.5 [tex]yd^{3}[/tex]

What is the volume of the prism?

The volume of a rectangular prism is given by the formula V = lwh, where l is the length, w is the width, and h is the height.

In this case, the length is 5 yards, the width is 5 yards, and the height is 3 and 1/2 yards. We can convert the height to a mixed number fraction of 7/2 yards.

Therefore, the volume of the prism is:

V = lwh = 5 yards × 5 yards × 7/2 yards = 87.5 cubic yards

So, the volume of the prism is 87 and 1/2 cubic yards or 87.5 [tex]yd^{3}[/tex]

to know more about volume

brainly.com/question/1578538

#SPJ1

A biologist is studying the growth of a particular species of algae. She writes the following equation to show the radius of the algae, f(d), in mm, after d days:

f(d) = 7(1.06)d

Part A: When the biologist concluded her study, the radius of the algae was approximately 13.29 mm. What is a reasonable domain to plot the growth function? (4 points)

Part B: What does the y-intercept of the graph of the function f(d) represent? (2 points)

Part C: What is the average rate of change of the function f(d) from d = 4 to d = 11, and what does it represent? (4 points)

Answers

Part A: A reasonable domain to plot the growth function would be from d = 0 to d = 11.

Part B: The y-intercept of the graph of the function f(d) is 7

Part C: The average rate of change of the function f(d) from d = 4 to d = 11 is approximately 0.64 mm/day.

Domine and y-intercept of a function:

The domain of a function represents the set of input values for which the function is defined and can produce a meaningful output.

The y-intercept of a function represents the value of the function when the input is equal to zero.

The average rate of change of a function from x = a to x = b is given by the slope of the secant line passing through the points (a, f(a)) and (b, f(b)).

Here we have

A biologist is studying the growth of a particular species of algae. She writes the following equation to show the radius of the algae, f(d), in mm, after d days:

=> f(d) = 7(1.06)^d

Since it is given that the radius of the algae was approximately 13.29 mm when the biologist concluded her study, we can set f(d) = 13.29  

=> 13.29 = [tex]7(1.06)^{d}[/tex]

=> ln(13.29/7) = d ln(1.06)

=> d = ln(13.29/7)/ln(1.06) ≈ 11  

Therefore, A reasonable domain to plot the growth function would be from d = 0 to d = 11.

Part B: The y-intercept of the graph of the function f(d) represents the value of the function when d = 0.

Substituting d = 0 into the given equation, we get:

f(0) = 7(1.06)⁰ = 7

Therefore, The y-intercept of the graph of the function f(d) is 7

Part C: The average rate of change of the function f(d) from d = 4 to d = 11 is given by the slope of the secant line passing through the points (4, f(4)) and (11, f(11)). Using the given equation, we can evaluate f(4) and f(11):

f(4) = 7(1.06)⁴ ≈ 8.84

f(11) = 7(1.06)¹¹ ≈ 13.29

The slope of the second line passing through these two points is:

Slope = (f(11) - f(4))/(11 - 4) = [ 13.29 - 8.84]/7 = 0.64

Therefore,

The average rate of change of the function f(d) from d = 4 to d = 11 is approximately 0.64 mm/day.

Learn more about Functions at

https://brainly.com/question/24839787

#SPJ1

The right triangle shown is enlarged such that each side is multiplied by the value of the hypotenuse, 3y. Find the expression that represents the perimeter of the enlarged triangle. TRIANGLE AND ANSWER CHOICES BELOW!

Answers

Answer:

c.

Step-by-step explanation:

The original triangle has two sides with length 4x each, and the hypotenuse has length 3y.

After the enlargement, each of the sides with length 4x becomes 3y × 4x = 12xy, and the hypotenuse becomes 3y × 3y = 9y^2.

Therefore, the perimeter of the enlarged triangle is the sum of the lengths of its three sides:

12xy + 12xy + 9y^2 = 24xy + 9y^2 = 9y^2 + 24xy

So the answer is (C) 9y^2 + 24xy.

19.
Solve the problem.
2
Find the critical value XR corresponding to a sample size of 5 and a confidence
level of 98%.
(1 point)
O11.143
00.297
13.277
00.484

Answers

The critical value of the chi-square distribution corresponding to a sample size of 5 and a confidence level of 98% is given as follows:

0.297 and 13.277.

How to obtain the critical value?

To obtain a critical value, we need three parameters, given as follows:

Distribution.Significance level.Degrees of freedom.

Then, with the parameters, the critical value is found using a calculator.

The parameters for this problem are given as follows:

Chi-square distribution.1 - 0.98 = 0.02 significance level.5 - 1 = 4 degrees of freedom.

Using a chi-square distribution calculator, the critical values are given as follows:

0.297 and 13.277.

More can be learned about the chi-square distribution at https://brainly.com/question/4543358

#SPJ1

Please answer the question in the pdf. I just need the values for A, B, and C. I am offering 15 points. Thanks.

Answers

Recall the equation provided in the pdf:

   (125x ^ 3 * y ^ - 12) ^ (- 2/3) = (y ^ [A])/([B] * x ^ [c])

find A B and C.

The answer will be:

A = 8/3B = 3/4C = 8/3

Checkout the calculation of the exponential

We can solve this problem using the rules of exponents and algebraic manipulation.

Starting with the left-hand side of the equation:

(125x^3 * y^-12)^(-2/3)

Using the rule that (a * b)^c = a^c * b^c, we can rewrite the expression as:

125^(-2/3) * x^(-2) * y^(8)

Simplifying further, we can use the fact that a^(-n) = 1/(a^n) to get:

1/(5^2 * x^2 * y^8/3)

Now, we can see that the denominator on the right-hand side of the equation must be 5^2 * x^2 * y^8/3. To find the numerator, we need to simplify the expression y^A. Comparing exponents, we see that:

y^A = y^(8/3)

Therefore, we need to find a value of A such that A = 8/3. Solving for A, we get:

A = 8/3

Now, we can write the equation as:

y^(8/3)/(5^2 * x^2 * y^8/3) = y^(8/3)/(25 * x^2 * y^(8/3))

Comparing exponents again, we see that we need to find values of B and C such that:

B * C = 2

and

-8/3 = -C

Solving for C, we get:

C = 8/3

Substituting this value of C into the first equation, we get:

B * 8/3 = 2

Solving for B, we get:

B = 3/4

Therefore, the solution is:

A = 8/3

B = 3/4

C = 8/3

Learn more about exponential algebra here:

https://brainly.com/question/12940982

#SPJ1

2. Which sequence of transformations takes the graph of y = k(x) to the graph of
y=-k(x + 1)?
A. Translate 1 to the right, reflect over the x-axis, then scale vertically by a factor of 1/2
B. Translate 1 to the left, scale vertically by 1/2 , then reflect over the y-axis.
C. Translate left by 1/2, then translate up 1.
D. Scale vertically by 1/2, reflect over the x-axis, then translate up 1.

Answers

The correct answer is option B. Translate 1 to the left, scale vertically by 1/2, then reflect over the y-axis.

What does term "transformation of a graph" means?

The process of modifying the shape, location, or features of a graph is often referred to as graph transformation. Graphs are visual representations of mathematical functions or data point connections, often represented on a coordinate plane.

Translations, reflections, rotations, dilations, and other changes to the look of a graph are examples of graph transformations.

For the given problem, Transformation to get the desired result can be carried out as:

Translate '1' to the left: The transformation "x + 1" in "-k(x + 1)" shifts the graph horizontally to the left by 1 unit.Scale vertically by '1/2' : The 1/2 factor in "-k(x + 1)" vertically scales the graph, compressing it vertically.Reflect over the y-axis: The minus sign before "k" in "-k(x + 1)" reflects the graph over the y-axis, flipping it horizontally.

Hence, to convert the graph of "y = k(x)" to the graph of "y = -k(x + 1)," the correct sequence of transformations is to translate 1 unit to the left, scale vertically by 1/2, and then reflect across the y-axis, which is option B.

Learn more about Graph Transformation here:

https://brainly.com/question/10059147

#SPJ1

A container built for transatlantic shipping is constructed in the shape of a right
rectangular prism. Its dimensions are 4 ft by 9.5 ft by 13 ft. If the container is entirely
full and, on average, its contents weigh 0.05 pounds per cubic foot, find the total
weight of the contents. Round your answer to the nearest pound if necessary

Answers

Thus, the on average the contents weight for the transatlantic shipping is found as  24.7  pounds.

Explain about the rectangular prism:a solid, three-dimensional object with six rectangular faces.It is a prism due to its uniform cross-section along its whole length.Volume is a unit of measurement for the amount of 3-dimensional space a thing occupies. Cubic units are used to measure volume.

Given dimension of rectangular prism

Length l = 4ft

width w = 9.5 ft

height h = 13 ft

Volume of rectangular prism = l*w*h

V = 4*9.5*13

V = 494 ft³

Now,

1  ft³ = 0.05 pounds

So,

weight of  494 ft³ =  494*0.05 pounds

weight of 494 ft³ =  24.7  pounds

Thus, the on average the contents weigh for the transatlantic shipping is found as  24.7  pounds.

know more about the rectangular prism

https://brainly.com/question/24284033

#SPJ1

During a flood, there were 6000 acres of land under water. After 2 days, only 3375 acres of land were under water. Assume that the water receded at an exponential rate. Write a function to model this situation that has a B-value of 1.

Answers

where t is measured in days, and A(t) represents the amount of flooded land at time t. This function has a B-value of -0.3118.

To model the situation of the flood, we can use an exponential decay function, which represents the decreasing amount of flooded land over time. The function can be written as:

[tex]A(t) = A0 * e^{(-kt)}[/tex]

where A(t) is the amount of flooded land at time t, A0 is the initial amount of flooded land, k is a constant representing the rate of decay, and e is the mathematical constant approximately equal to 2.718.

To determine the value of k, we can use the given information that after 2 days, only 3375 acres of land were under water. Substituting t = 2 and A(t) = 3375 into the equation above, we get:

[tex]3375 = A0 * e^{(-2k)[/tex]

We also know that initially, there were 6000 acres of land under water. Substituting A0 = 6000 into the equation above, we get:

Dividing both sides by 6000, we get:

ln(0.5625) = -2k[tex]ln(0.5625) = -2k[/tex]

Taking the natural logarithm of both sides, we get:

[tex]ln(0.5625) = -2k[/tex]

Solving for k, we get:

[tex]k = -ln(0.5625)/2[/tex]

k ≈ 0.3118

Therefore, the function to model the situation of the flood is:

[tex]A(t) = 6000 * e^{(-0.3118t)}[/tex]

To learn more about function, visit

https://brainly.com/question/12431044

#SPJ1

PLEASE HELP DUE TODAY

Answers

Answer:

y=-1/12x+61/12

Step-by-step explanation:

y=-1/12x+61/12

An animal population N(t) is modeled by the differential equation:
dN/dt = -0. 001N(N - 110)(N - 99). If N(0)=A, where A is a positive integer, what is the maximum value of the positive integer A such that extinction will occur?

Answers

For the given integer, the maximum starting population size that will eventually lead to extinction is 98, since any larger value will result in the population either stabilizing at a positive value or growing indefinitely.

The equation in question is:

dN/dt = -0.001N(N - 110)(N - 99)

Here, N represents the population size, and dN/dt represents the rate of change of the population with respect to time. The right-hand side of the equation tells us how the population size changes over time, and it's determined by the current population size N, as well as the two constants 110 and 99.

We can do this by setting dN/dt equal to zero and solving for N:

dN/dt = -0.001N(N - 110)(N - 99) = 0

=> N = 0, N = 99, N = 110

We can then plot the direction field (i.e., arrows indicating the direction of change) on each interval, and use this to determine the behavior of the solution curve. In this case, we can see that the direction of the arrows changes at each critical point, indicating that the population behavior switches between growing and declining as we move from one interval to the next.

Specifically, we can see that if the initial population size A is less than 99, the population will decline to extinction. If the initial population size is between 99 and 110, the population will initially decline but then grow and eventually stabilize at N = 110. If the initial population size is greater than 110, the population will grow exponentially and tend towards infinity.

To know more about integer here

https://brainly.com/question/15276410

#SPJ4

9) Given f-¹(x)=-3x+2, write an equation
that represents f(x).

Answers

as you already know, to get the inverse of any expression we start off by doing a quick switcheroo on the variables and then solving for "y", let's do so for this inverse, since finding the inverse of the inverse, will give us the original function :)

[tex]f^{-1}(x)=-3x+2\implies y~~ = ~~-3x+2\hspace{5em}\stackrel{\textit{quick switcheroo}}{x~~ = ~~-3y+2} \\\\\\ x-2=-3y\implies \cfrac{x-2}{-3}=y\implies \cfrac{2-x}{3}=y=f(x)[/tex]

Solve for x to make A||B.
A = x + 12
B = x + 48

X = [?]

Answers

Answer:

Step-by-step explanation:= x+48=180 ( linier pair )

                                            = x=180-48

                                            = x=132

                                         

                                              = x+12=180 (liner pair)

                                              = x=180-12

                                              = x=168

the applet is selecting random samples from the town's population this year. what do we assume is true about this population of babies?

Answers

When the applet selects random samples from the town's population of babies, we assume that the population is large enough and diverse enough to accurately represent the characteristics and traits of the entire population.

We assume that the selection of the random samples is unbiased and that every member of the population has an equal chance of being selected for the sample.

Based on your question, we are discussing random samples taken from a town's population of babies this year. When selecting random samples from this population, we assume the following:

1. The population of babies is well-defined and includes all babies born in the town within the specified year.
2. The random samples are representative of the entire population, meaning that each baby has an equal chance of being selected in the sample.
3. The samples are independent, meaning that the selection of one baby does not influence the selection of another.

These assumptions ensure that the results obtained from the random samples can be generalized to the entire population of babies in the town for this year.

Learn more about random samples here:

https://brainly.com/question/15736806

#SPJ11

By assuming these conditions are met, we can perform statistical analyses on the random samples and make valid inferences about the entire population of babies in the town.

When an applet is selecting random samples from a town's population of babies this year, we typically assume the following about the population:
Independence:

Each baby selected in the sample is independent of the others, meaning that the outcome of one selection does not affect the outcome of another selection.
Randomness:

The applet chooses babies from the population in a random manner, ensuring that every baby has an equal chance of being selected.

Representativeness:

The random samples selected are representative of the entire population, meaning that the samples accurately reflect the characteristics of the town's population of babies as a whole.

For similar question on conditions.

https://brainly.com/question/28532738

#SPJ11

Using the graph, determine the coordinates of the x-intercepts of the parabola.

Answers

Answer:

x = -5, x = 1

As (x, y) coordinates, the x-intercepts are (-5, 0) and (1, 0).

Step-by-step explanation:

The x-intercepts are the x-values of the points at which the curve crosses the x-axis, so when y = 0.

From inspection of the given graph, we can see that the parabola crosses the x-axis at x = -5 and x = 1.

Therefore, the x-intercepts of the parabola are:

x = -5x = 1

As (x, y) coordinates, the x-intercepts are (-5, 0) and (1, 0).

the x intercepts are 1 and-5

a random sample of n equal to 64 scores is selected from a normally distributed population with mu equal to 77 and sigma equal to 21. what is the probability that the sample mean will be less than 79? hint: this is a z-score for a sample.

Answers

The probability of the sample mean being less than 79 is 77.64%

In order to solve the given problem we have to take the help of Standard error mean

SEM = ∑/√(n)

here,

∑ = population standard deviation

n = sample size

hence, the z-score can be calculated as

z = ( x' - μ)/σ/√(n)

here,

x' = sample mean

μ = population mean

σ = population standard deviation

n = sample size

adding the values into the formula

SEM = σ / √(n)

= 21/√64

= 2.625

z = (x' - μ)/SEM

= (79-77)/2.625

= 0.76

now, using standard distribution table we find that probability of a z-score is less than 0.77 then converting it into percentage

0.77 x 100

= 77%

The probability of the sample mean being less than 79 is 77.64%

To learn more about probability,

https://brainly.com/question/13604758

#SPJ4

Find the three trigonometric ratios. If needed, reduce fractions.

Answers

Soh Cah Toa

Sin= 15/17 opposite/hypotenuse
Cos= 8//17 adjacent/ hypotenuse
Tan= 15/8 opposite/ adjacent

In triangle ∆ABC, m<A = 33°, m<C = 58°, and AB = 25 in. What is AC to the nearest tenth of an inch?

1. 16.1 in.
2. 38.9 in
3. 42 in.
4. 12 in.​​​

Answers

The value of AC to the nearest tenth is 29.5

What is sine rule?

The sine rule states that if a, b and c are the lengths of the sides of a triangle, and A, B and C are the angles in the triangle; with A opposite a, etc., then a/sinA=b/sinB=c/sinC.

Angle B = 180-(33+58)

= 180-91 = 89°

using sine rule

represent AC by x

x/ sin89 = 25/sin 58

xsin58 = 25sin89

0.848x = 0.9998×25

0.848x = 24.995

x = 24.995/0.848

x = 29.5( nearest tenth)

therefore the value of AC is 29.5.

learn more about sine rule from

https://brainly.com/question/20839703

#SPJ1

Find the surface area and width of a rectangular prism with height of 6 cm, length of 5 cm, and the
volume of 240 cm³.

Answers

236 cm2 is the surface area

Answer:

236 cm^2  and  8 cm

Step-by-step explanation:

width=w

240=6(5)(w)

w=8 cm

area=2[(6)(5)+(6)(8)+(5)(8)]

area=236 cm^2

The Olympic record for the men's 50-meter freestyle is 21.91 seconds. Express this speed in meters per second

Answers

Answer:

50 meters/21.91 seconds = 2.282 m/sec

The solid below is dilated by a scale factor of 1/2. Find the volume of the
solid created upon dilation.
24
26
10
34

Answers

Answer: 4080

Step-by-step explanation:

First you have to find the area of the triangle. 24*10 = 240. 240/2 = 120. Then you multiply the area of the triangle and multiply it by 34. 120 * 34 = 4080. This means the answer is 4080

rylie is a newly hired cybersecurity expert for a government agency. rylie used to work in the private sector. she has discovered that, whereas private sector companies often had confusing hierarchies for data classification, the government's classifications are well known and standardized. as part of her training, she is researching data that requires special authorization beyond normal classification. what is this type of data called? group of answer choices

Answers

Compartmentalized is the type of data that is discussed in the problem researched by an employee rylie who is a newly hired cybersecurity expert for a government agency and has working experience in the private sector.

Data classification is the way of organizing data into different categories that make it easy to retrieve, sort and store for future use. In simple words, compartmentalization means to separate into isolated compartments or categories. In data language, A nonhierarchical grouping of information used to control access to data more finely than with hierarchical security classification alone is called Compartmentalization. Now, we have a rylie who is a newly hired cybersecurity expert for a government agency. She has working experience in the private sector. On basis of her experience she has discovered that, the private sector companies often had confusing hierarchies for data classification as compared to the government's classifications which are well known and standardized. During her training, she is researching data that requires special authorization beyond normal classification. The data type that she researched and that is authorization beyond normal classification is called compartmentalized data.

For more information about data classification, visit :

https://brainly.com/question/30580761

#SPJ4

true or false: a linear programming problem can have an optimal solution that is not a corner point. select one: true false

Answers

It is true that a linear programming problem can have an optimal solution that is not a corner point.

How given statement is true? Explain further?

In linear programming, the optimal solution represents the point where the objective function is optimized while still satisfying all the constraints.

In some cases, the optimal solution may occur at a corner point of the feasible region, where two or more of the constraints intersect.

However, it is possible for the optimal solution to occur at a point that is not a corner point, but rather lies on an edge or a line segment of the feasible region.

This can occur when the objective function is parallel to one of the constraint lines or when there are redundant constraints that limit the feasible region.

Therefore, it is true that a linear programming problem can have an optimal solution that is not a corner point.

Learn more about linear programming.

brainly.com/question/15417573

#SPJ11

the profit p (in dollars) generated by selling x units of a certain commodity is given by the function p ( x ) = - 1500 + 12 x - 0.004 x ^ 2 What is the maximum profit, and how many units must be sold to generate it?

Answers

The profit (p) is $7500 generated by selling 1500 units of a certain commodity is given by the function p ( x ) = - 1500 + 12 x - 0.004 x²

To maximize our profit, we must locate the vertex of the parabola represented by this function. The x-value of the vertex indicates the number of units that must be sold to maximize profit.

We may use the formula for the x-coordinate of a parabola's vertex:

x = -b/2a

where a and b represent the coefficients of the quadratic function ax² + bx + c. In this situation, a = -0.004 and b = 12, resulting in:

x = -12 / 2(-0.004) = 1500

This indicates that when 1,500 units are sold, the profit is maximized.

To calculate the greatest profit, enter x = 1500 into the profit function:

P(1500) = -1500 + 12(1500) - 0.004(1500)^2

P(1500) = -1500 + 18000 - 9000

P(1500) = $7500

Therefore, the maximum possible profit is $7,500 and it is generated when 1,500 units are sold.

Learn more about Profit maximization:

https://brainly.com/question/30436087

#SPJ4

To achieve this maximum profit, exactly 1500 units must be sold.


To find the maximum profit and the number of units needed to generate it, we can use the given profit function p(x) = -1500 + 12x - 0.004x^2. We need to find the vertex of the parabola represented by this quadratic function, as the vertex will give us the maximum profit and the corresponding number of units.

Step 1: Identify the coefficients a, b, and c in the quadratic function.
In p(x) = -1500 + 12x - 0.004x^2, the coefficients are:
a = -0.004
b = 12
c = -1500

Step 2: Find the x-coordinate of the vertex using the formula x = -b / (2a).
x = -12 / (2 * -0.004) = -12 / -0.008 = 1500

Step 3: Find the maximum profit by substituting the x-coordinate into the profit function p(x).
p(1500) = -1500 + 12 * 1500 - 0.004 * 1500^2
p(1500) = -1500 + 18000 - 0.004 * 2250000
p(1500) = -1500 + 18000 - 9000
p(1500) = 7500

So, the maximum profit is $7,500, and 1,500 units must be sold to generate it.

To learn more about parabola: brainly.com/question/8227487

#SPJ11

help me please like right now as soon as possible write the answer in terms of pi and round the answer to the nearest hundredths place I will give branliest

Answers

Thus, the total surface area of cylinder is found to be 480π sq. cm.

Explain about the surface area of cylinder:

A cylinder's surface area is made up of its two congruent, parallel circular sides added together with its curved surface area. You must determine the Base Area (B) and Curved Surface Area in order to determine the surface area of a cylinder (CSA).

As a result, the base area multiplied by two and the area of a curved surface add up to the surface area or total surface of a cylinder.

Given data:

radius r = 8 cm

Height h = 22 cm

Total surface area of cylinder = 2*area of circle + area of curved cylinder

TSA = 2πr² + 2πrh

TSA = 2π(8)² + 2π(8)(22)

TSA = 2π(64) + 2π(176)

TSA = 128π + 352π

TSA = 480π sq. cm.

Thus, the total surface area of cylinder is found to be 480π sq. cm.

Know more about the surface area of cylinder:

https://brainly.com/question/27440983

#SPJ1

Complete question-

Find the surface area of the cylinder with radius of 8 cm and height of 22 cm. write the answer in terms of pi and round the answer to the nearest hundredths place.

Help please? I just need an answer. A clear explanation earns brainliest.

Answers

the simplified  form  of expression is: -(x² + 2x - 2)/((x+2)*(x+4))

what is expression  ?

In mathematics, an expression is a combination of numbers, variables, operators, and/or functions that represents a mathematical quantity or relationship. Expressions can be simple or complex

In the given question,

To evaluate the expression 1/(x+2) - (x+1)/(x+4), we need to find a common denominator for the two terms. The least common multiple of (x+2) and (x+4) is (x+2)(x+4).

So, we can rewrite the expression as:

(1*(x+4) - (x+1)(x+2))/((x+2)(x+4))

Expanding the brackets, we get:

(x+4 - x² - 3x - 2)/((x+2)*(x+4))

Simplifying the numerator, we get:

(-x² - 2x + 2)/((x+2)*(x+4))

Therefore, the simplified expression is:

-(x² + 2x - 2)/((x+2)*(x+4))

To know more about  Expressions , visit:

https://brainly.com/question/14083225

#SPJ1

Other Questions
The city state of Venice should only be governed by merchants who understand buisness and not by catholic clergy who only understand the Bible ? explain why we call the national halothane study an observational study rather than an experiment, even though it compared the results of using different anesthetics in actual surgery.in order to be an experiment, the subjects would have to be randomly selected from the population. however, these are hospital patients who all have some disease or condition and have not been randomly selected from the population, which includes both healthy and sick people.in order to be an experiment, the treatments (choice of anesthetic) would have to be randomly assigned. instead, a patient's anesthetic is selected by his or her doctor(s).there is not enough information to say for sure, but it is safer to assume that it is only an observational study, so that we are not overconfident about the results.actually, it is an experiment and not an observational study. Your task is to implement a simplified inventory tracker system for a large retail store. You are given a price list that describes the current A small tree that is 8 feet tall casts a 4-foot shadow, while a building that is 24 feet tall casts a shadow in the same direction. Determine the length of the building's shadow. 6 feet 12 feet 18 feet 48 feet Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse the data from the table of thermodynamic properties to calculate the value of rxnat 25.0 C.Srxn= ? JK1Calculate rxn.Grxn= ? kJIn which direction is the reaction, as written, spontaneous at 25 Cand standard pressure?reversebothneitherforward Please help!! URGENT!! I dont understand inferred the reason why the droeshout engraving and Shakespeare statue are considered unreliable davie inc. has a pre-tax cost of debt of 8.6 percent, a cost of equity of 13.4 percent, and a cost of preferred stock of 8.5 percent. the firm has 240,000 shares of common stock outstanding at a market price of $27 a share. there are 25,000 shares of preferred stock outstanding at a market price of $33 a share. the bond issue has a face value of $540,000 and a market price of 102.1 percent of face value. the company's tax rate is 34 percent. what is the firm's weighted average cost of capital? Select the verb : Gregory Eddie had planted an apple tree in the yard. Problem 9-34 Risk, Return, and Their Relationship (LG9-3, LG9-4) Consider the following annual returns of Molson Coors and International Paper: Year 1 Year 2 Year 3 Year 4 Molson Coors 17.88 - 8.7 38.0 International Paper 4.8% -17.8 -0.5 26.9 -11.4 - 7.5 Year 5 16.5 Compute each stock's average return, standard deviation, and coefficient of variation. (Round your answers to 2 decimal places.) Molson Coors 11.22 % Average return Standard deviation International Paper 0.40% % % Coefficient of variation Which stock appears better? O International Paper O Molson Coors the commander and his staff must work to clearly display objectives and end states by phase, demonstrating explicitly their incorporation of what elements of design? (select all that apply.) At the start of 1996, the annual interest rate was 8 percent in the United States and 4.8 percent in Japan. The exchange rate was 108 yen per dollar at the time. Mr. Jorus, who is the manager of a Bermuda-based hedge fund, thought that the substantial interest advantage associated with investing in the United States relative to investing in Japan was not likely to be offset by the decline of the dollar against the yen. He thus concluded that it might be a good idea to borrow in Japan and invest in the United States. At the start of 1996, in fact, he borrowed \1,000 million for one year and invested in the United States. At the end of 1996, the exchange rate became 118 yen per dollar. How much profit did Mr. Jorus make in dollar terms? Answer is complete but not entirely correct. Profit $ 143,576,944 HELP ME PLS1. If the diameter of a circle is segment AB where Point A is located at (-3, 6), and Point B located at (-8,-1), what is the diameter of the circle? 221467474 What key component within the changing culture of readiness refers to leaders presenting information necessary for deployability determinations in a manner that truly depicts unit readiness Urgent, please help! You bought 1,000 shares of Altona Ltd 5 years ago. Over the years you have attended the annual general meetings and carefully read through Altona Ltds financial statements. While you have been generally satisfied with the amount of annual dividends, recently you have become a little concerned with declining share prices. You became particularly alarmed when media published several photos showing Altona managements Hawaiian management retreats. Taking into consideration the management behaviour critically discuss the relationship between a corporations shareholders and management. Analyse the problems and costs related to this relationship and explain with example how a company may structure management compensation to mitigate such costs. According to a NASA study of satellite data, the massof the Antarctic ice sheet increased by 112 billiontons of ice each year from 1992 to 2001. For theseyears, which of the following types of functions bestmodels the mass, in tons, of the Antarctic ice sheet asa function of time, in years?A) Increasing linearB) Decreasing linearC) Increasing exponentialD) Decreasing exponential Green laser pointers emit light with a wavelength of 532 nm. Do research on the type of laser used in this type of pointer and describe its operation. Indicate whether the laser is pulsed or continuous. what is the therapeutic effect for the administration of pyridostigmine extended-release at bedtime? The function V(t) = 30000(0.85) value V(t) represents the values v(t) of Nancy's car after t years. What is the depreciation rate of Nancy's car?