Answer:
75 less student tickets than adult tickets. The total is 625 tickets. So the student and adult tickets have to equal 625 when added.
Step-by-step explanation:
Student tickets: 275
Adult tickets: 350
write 56.78 correct to one significant number
Answer:
60
Step-by-step explanation:
what is 2 over 5 simplafied
Answer:
2/5 simplified is 1/2.5 or .4
Step-by-step explanation:
You simplify by dividing the numerator by the denominator. Thus 2/5 is
.40.
Hope this helps!
Please help me out!!!!!
At a food festival, 3/8 of the dishes were from china. Another 12.5% of the dishes were from japan. What percent of the dishes were from the other countries?
Answer: 50%
Step-by-step explanation:
Let x = Total dishes.
Dishes from China = [tex]\dfrac38x[/tex]
Dishes from Japan = [tex]12.5\% \text{ of }x= 0.125x[/tex]
Total dishes from China and Japan = [tex]\dfrac38 x+0.125x=0.375x+0.125x=0.5x[/tex]
Dishes from other countries [tex]= x- 0.5x= 0.5x[/tex]
Percent of dishes from other countries= [tex]\dfrac{0.5x}{x}\times100\%= 50\%[/tex]
Hence, dishes from other countries = 50%
Evaluate: 21x: 8 when x = 4*
Answer:
10.5
Step-by-step explanation:
21(4) / 8
84 / 8
10.5
What is an equation of the line that passes through the points (7, 6) and (-2, -3)?
Answer:
y=1x-1
Step-by-step explanation:
m=y2-y1/x2-x1
-3-6=(-9)
-2-7=(-9)
-9/-9=1
6=1*7+b
1*7=7
7-7=0
6-7=-1
b=-1
y=1x-1
hope this helps :3
if it did pls mark brainliest
Determine the values of X
Step-by-step explanation:
x+66+52=180
x=180-66-52
x=180-118
x=62
HeLp Me pLz
What is the shape of the cross section of the figure that is perpendicular to the triangular bases and passes through a vertex of the triangular bases?
A triangular prism.
a parallelogram that is not a rectangle
a rectangle
a triangle that must have the same dimensions as the bases
a triangle that may not have the same dimensions as the bases
T-shirts and More Print Shop will print any image on a mouse pad for a cost of $2 per mouse pad and a one-time charge of $12 to set up the mouse pad design. The total cost of an order was $562. How many mouse pads were printed?
A:47
B:275
C:550
D:281
Answer: 275
Step-by-step explanation:
write the coordinates obtained after the given translation
Answer:You would just have to add 4 to all of the x values and add 5 to all the y values
Step-by-step explanation:
Bernard says “When you halve a whole number that ends in 8, you always
get a number that ends in 4”
Write down an example to show that Bernard is wrong.
is this a trick question?
Answer:
Bernad is WRONG.
Step-by-step explanation:
Let us take the number '18' (ends with 8)
The half of 18 is '9' (doesn't end with 4)
Let us take the number '38' (ends with 8)
The half of 38 is '19' (doesn't end with 4)
Therefore, Bernard is wrong.
Bernard is wrong because When you halve a whole number that ends in 8, you always cannot get a number that ends in 4”
What is an arithmetic operation?It is defined as the operation in which we do the addition of numbers, subtraction, multiplication, and division. It has a basic four operators that is +, -, ×, and ÷.
It is given that:
Bernard says “When you halve a whole number that ends in 8, you always get a number that ends in 4”
It can be written mathematically:
Let's suppose the number is '18' (ends with 8)
The half of 18 = 9 (doesn't end with 4)
Let's suppose the number is '38' (ends with 8)
The half of 38 = 19 (doesn't end with 4)
Thus, Bernard is wrong because When you halve a whole number that ends in 8, you always cannot get a number that ends in 4”
Learn more about the arithmetic operation here:
brainly.com/question/20595275
#SPJ2
I need help on the word problem with
hirhgkjsdbgkgbdk kbfsbjd jsbfbdh jabjdbshd jsjdsfkj
Answer: x>11
Step-by-step explanation:
Lin’s bike travels 100 meters when her wheels rotate 55 times. What is the circumference of her wheels?
____ m
Answer:
the circumference of her wheel is 1.81 mLin’s bike travels 100 meters when her wheels rotate 55 times.
here, n = 55 rotation and D = 100 meter.
Diameter is the distance bike travel
n is the number of times rotation
C is the circumference of the wheel
What is the value of c?
There are 9.4 hours of music left on Nate's playlist and this is 47% of the total memory how much memory does Nate's MP3 player have? Please answer
Answer:
Nate's MP3 has 20 hours of memory.
Step-by-step explanation:
1. multiply 9.4 times 100
2. divide that by 47
3. you get your answer of 20 hours
Which expression is equivalent to – (4-3)?
A. -2(to the power of 2) + 3
B. -2(to the power of 2)– 3
C. -3 - 2(to the power of 2)
D. -3 +2(to the power of 2)
Answer:
answer is really hard and small, but I can't help because I don't know,
sorry not sorry
lol
regards,
Rosemary
which expression is equivalent to sin(pi/12)cos(7pi/12)-cos(pi/12)sin(7pi/12)? a) cos(-pi/2) b) sin(-pi/2) c) cos(2pi/3) d) sin(2pi/3)
Answer:A
Step-by-step explanation:
Edge 2020
[tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] is equivalent to [tex]sin(\frac{-\pi }{2} )[/tex].
What is trigonometric expression?Trigonometric expressions are non-routine appearing problems. They are unfamiliar because the language of trigonometry looks foreign and complicated. In order to learn how to simplify or reduce the complexity of trigonometric expressions, we first need to examine the identities we need to utilize.
It is one of the identities of trigonometry
sinAcosB - cosAsinB = sin(A - B)
Given expression
[tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex]
It is in form of sinAcosB - cosAsinB = sin(A - B)
⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{\pi }{12}-\frac{7\pi }{12} )[/tex]
⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{-6\pi }{12} )[/tex]
⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{-\pi }{2} )[/tex]
Hence [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] is equivalent to [tex]sin(\frac{-\pi }{2} )[/tex].
Find out more information about trigonometric expression here
https://brainly.com/question/2142049
#SPJ2
solve the equation
-4(x - 26) = -200
Answer:
x=76
Step-by-step explanation:
-4(x - 26) = -200
x-26=50
x=50+26
x=76
I hope this helped you! If it did, please consider rating, pressing thanks, and giving my answer 'Brainliest.' Have a great day! :)
Step-by-step explanation:
-4x+104=-200
-4x=-200-104
-4x=-304
x=-304÷(-4)
×=76
Help pls help pls help pls help pls help pls
Answer:
Domain: -2 < x ≤ 3
General Formulas and Concepts:
Algebra I
Domain is the set of x-values that can be inputted into function f(x)Step-by-step explanation:
Since domain encompasses x values only, we are looking at the x-values of the graph. We see that our x-values span from -2 to 3. However, since x = -2 is a open dot, it is NOT included in the domain. Since x = 3 is a closed dot, it IS included in the domain:
(-2, 3] or -2 < x ≤ 3
Answer:
ramen is the true answer to lifes problems
Step-by-step explanation:
Suppose that 2000 is placed in an account that pays 13% interest compounded each year. Assume that no withdrawals are made from the account. Do not do any rounding.
A:Find the amount in the account at the end of 1 year.
B: Find the amount in the account at the end of 2 years.
The amount will be $2260 in the account at the end of 1 year. The amount will be $2553.8 in the account at the end of 2 years.
What is Compound interest?Compound interest is defined as interest paid on the original principal and the interest earned on the interest of the principal.
A = P(1+r/100)ⁿ
Where:
A = the future value of the investment or loan
P = the principal investment or loan amount
r = the interest rate (decimal)
n = the number of compound periods
As per the question, the given data will be:
p = $2000
r = 13%
t = 1 year
To calculate the amount in the account at the end of 1 year.
A = P(1+r/100)ⁿ
Substitute the values of p,r, and t in the formula,
A = 2000(1 + 13/100)¹
A = 2000(1 + 0.13)¹
A = 2000(1.13)
A = $2260
To calculate the amount in the account at the end of 2 years.
A = 2000(1 + 13/100)²
A = 2000(1 + 0.13)²
A = 2000(1.13)²
A = $2553.8
Thus, the amount will be $2260 in the account at the end of 1 year. The amount will be $2553.8 in the account at the end of 2 years.
To learn more about Compound interest click here:
brainly.com/question/25857212
#SPJ2
3. Solve for a
5(a-2) = 2(10+a)
it’s due by midnight and can you also tell me how you got the answer
Answer:
a=10
Step-by-step explanation:
distribute on both sides to get
5a-10=20+2a
add/subtract like terms
5a-2a=3a
20+10=30
so the equation is
3a=30
divide 30 by 3 and you get 10
Answer:
a = 10
Step-by-step explanation:
[tex]5(a - 2) = 2(10 + a) \\ \\ 5a - 10= 20 + 2a\\ \\ 5a - 2a= 20 + 10\\ \\ 3a = 30\\ \\ a = \frac{30}{3} \\ \\ \huge \red{ \boxed{a = 10}}[/tex]
riddle
What runs around the whole yard without moving?
Answer:
a yard stick, maybe I'm right
Answer:
a fence
Step-by-step explanation:
HAHAHA LOL
Here are the first four terms of an arithmetic sequence. 3 10 17 24 Find, in terms of n, an expression for the nth term of this arithmetic sequence.
Answer:
[tex]a_{n}[/tex] = 7n - 4
Step-by-step explanation:
The n th term of an arithmetic sequence is
[tex]a_{n}[/tex] = a₁ + (n - 1)d
where a₁ is the first term and d the common difference
Here a₁ = 3 and d = a₂ - a₁ = 10 - 3 = 7 , thus
[tex]a_{n}[/tex] = 3 + 7(n - 1) = 3 + 7n - 7 = 7n - 4
Divide (-3x^2 - 9x) ÷ (x + 3)
please explain/show work! <33
Step-by-step explanation:
[tex]( - 3 {x}^{2} - 9x) \div (x + 3) [/tex]
This is the original equation so you will open the brackets.
[tex] - 3 {x}^{2} - 9x \div x + 3[/tex]
The x will cross the division sign making it times x.
[tex]3 {x}^{2} - 9x \times x = 3[/tex]
So you will proceed to multiply the 9x by x making it;
[tex]3 {x}^{2} - 9 {x}^{2} = 3 [/tex]
So you will subtract 9x² from 3x² which won't be possible so it will be negative.
[tex] - 6 {x}^{2} = 3 [/tex]
Then you will square root both sides making it;
[tex] - \sqrt{6 {x}^{2} } = \sqrt{3} [/tex]
So the ² will cancel the √ leaving
-6x=√3
-6x=1.73(Divide both sides by -6)
x=0.288
That's the final answer.
Which of the following mixtures will have a stronger coffee flavor? explain please thank you!!
A) Mixture B
B) Mixture A
C) Both the mixtures are equally strong.
HELP ASP!!❤️
WILL GIVE BRAINLIEST!...
Find the slope of the line. Enter your answer in simplest form.
Answer:
[tex]m=\frac{-4}{3}[/tex]
General Formulas and Concepts:
Order of Operations: BPEMDASSlope Formula: [tex]m=\frac{y_2-y_1}{x_2-x_1}[/tex]Step-by-step explanation:
Step 1: Define
Point (-6, 5)
Point (3, -7)
Step 2: Find slope m
Substitute: [tex]m=\frac{-7-5}{3-(-6)}[/tex]Simplify: [tex]m=\frac{-7-5}{3+6}[/tex]Subtract/Add: [tex]m=\frac{-12}{9}[/tex]Simplify: [tex]m=\frac{-4}{3}[/tex]Answer:
the slope is -4/3
Step-by-step explanation:
m=y2-y1/x2-x1
-7-5=(-12)
3-(-6)=9
-12/9
-12/3=(-4)
9/3=3
-4/3
hope this helps :3
if it did pls mark brainliest
-6t-7=17 what does t equal
Answer:
t=-4
Step-by-step explanation:
I know you don't care about any explanation, and just want the answer, but to get this, you can add 7 to both sides. Then you get -6t=24. Divide both sides by -6 and you get -4
Brainliest 5 stars Thanks! (running out of time and points sorry)
What is the volume of a cylinder with a radius of 1.5 inches and a height of 9 inches round your answer to the nearest hundredthWhat is the volume of a cylinder with a radius of 1.5 inches and a height of 9 inches round your answer to the nearest hundredth
Answer:
V = 63.62
Step-by-step explanation:
Answer: 63.62 cubic inches
Step-by-step explanation:
REMEMBER :: VOLUME OF CYLINDER = πr^2h
r= 1.5 in.
h= 9 in.
V= π (1.5)^2 (9)
V= π (2.25) (9)
V= π (20.25)
V~63.6172512...
nearest hundredth = 63.62 cubic inches
What is the value of p? Please provide an explanation, thanks!
Answer:
p = 2?
Step-by-step explanation:
6 - 4 = 2
4 + _ = 6 (2)
2 + 2 = 4
Answer:
Step-by-step explanation:
6p - 4 + 4p + 6 + p + 2 = 180
11p + 4 = 180
11p = 176
p = 16